missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
p-Nitrophenyl phosphate disodium salt hexahydrate, >99%, MP Biomedicals™
$74.08 - $1219.79
Chemical Identifiers
| CAS | 4264-83-9 |
|---|---|
| Molecular Formula | C6H4NNa2O6P |
| Molecular Weight (g/mol) | 263.05 |
| MDL Number | MFCD00007319 |
| InChI Key | VIYFPAMJCJLZKD-UHFFFAOYSA-L |
| Synonym | pnpp, disodium 4-nitrophenylphosphate, sodium 4-nitrophenyl phosphate, disodium 4-nitrophenyl phosphate, phosphoric acid, mono 4-nitrophenyl ester, disodium salt, disodium p-nitrophenyl phosphate, phosphoric acid, mono 4-nitrophenyl ester, sodium salt 1:2, p-nitrophenyl phosphate, pnpp liquid substrate system |
| PubChem CID | 77949 |
| SMILES | [Na+].[Na+].[O-][N+](=O)C1=CC=C(OP([O-])([O-])=O)C=C1 |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
ICN10087801
|
MP Biomedicals Inc
0210087801 |
1 g |
Each for $74.08
|
|
|||||
|
ICN10087805
|
MP Biomedicals Inc
0210087805 |
5 g |
Each for $182.90
|
|
|||||
|
ICN10087850
|
MP Biomedicals Inc
0210087850 |
50 g |
Each for $1,219.79
|
|
|||||
Chemical Identifiers
| 4264-83-9 | |
| 263.05 | |
| VIYFPAMJCJLZKD-UHFFFAOYSA-L | |
| 77949 |
| C6H4NNa2O6P | |
| MFCD00007319 | |
| pnpp, disodium 4-nitrophenylphosphate, sodium 4-nitrophenyl phosphate, disodium 4-nitrophenyl phosphate, phosphoric acid, mono 4-nitrophenyl ester, disodium salt, disodium p-nitrophenyl phosphate, phosphoric acid, mono 4-nitrophenyl ester, sodium salt 1:2, p-nitrophenyl phosphate, pnpp liquid substrate system | |
| [Na+].[Na+].[O-][N+](=O)C1=CC=C(OP([O-])([O-])=O)C=C1 |
Specifications
| 4264-83-9 | |
| >99% | |
| MFCD00007319 | |
| pnpp, disodium 4-nitrophenylphosphate, sodium 4-nitrophenyl phosphate, disodium 4-nitrophenyl phosphate, phosphoric acid, mono 4-nitrophenyl ester, disodium salt, disodium p-nitrophenyl phosphate, phosphoric acid, mono 4-nitrophenyl ester, sodium salt 1:2, p-nitrophenyl phosphate, pnpp liquid substrate system | |
| [Na+].[Na+].[O-][N+](=O)C1=CC=C(OP([O-])([O-])=O)C=C1 | |
| 263.05 | |
| 371 | |
| p-Nitrophenyl phosphate disodium salt hexahydrate |
| White to Yellow | |
| C6H4NNa2O6P | |
| 1 g | |
| VIYFPAMJCJLZKD-UHFFFAOYSA-L | |
| disodium;(4-nitrophenyl) phosphate | |
| 77949 | |
| Crystalline Powder |