missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Phenyl Benzoate 99.0+%, TCI America™
$47.40 - $535.22
Chemical Identifiers
| CAS | 93-99-2 |
|---|---|
| Molecular Formula | C13H10O2 |
| Molecular Weight (g/mol) | 198.221 |
| MDL Number | MFCD00003072 |
| InChI Key | FCJSHPDYVMKCHI-UHFFFAOYSA-N |
| Synonym | benzoic acid phenyl ester, diphenylcarboxylate, benzoic acid, phenyl ester, benzoic acid phenyl, phenylbenzoate, unii-b8a3wvz590, phenol, benzoate, dsstox_cid_28185, dsstox_rid_82744, dsstox_gsid_48210 |
| PubChem CID | 7169 |
| ChEBI | CHEBI:86919 |
| IUPAC Name | phenyl benzoate |
| SMILES | C1=CC=C(C=C1)C(=O)OC2=CC=CC=C2 |
Chemical Identifiers
| 93-99-2 | |
| 198.221 | |
| FCJSHPDYVMKCHI-UHFFFAOYSA-N | |
| 7169 | |
| phenyl benzoate |
| C13H10O2 | |
| MFCD00003072 | |
| benzoic acid phenyl ester, diphenylcarboxylate, benzoic acid, phenyl ester, benzoic acid phenyl, phenylbenzoate, unii-b8a3wvz590, phenol, benzoate, dsstox_cid_28185, dsstox_rid_82744, dsstox_gsid_48210 | |
| CHEBI:86919 | |
| C1=CC=C(C=C1)C(=O)OC2=CC=CC=C2 |
Specifications
| 93-99-2 | |
| White | |
| C13H10O2 | |
| 25 g | |
| FCJSHPDYVMKCHI-UHFFFAOYSA-N | |
| phenyl benzoate | |
| 7169 | |
| 198.22 | |
| Crystalline Powder |
| 70°C | |
| 314°C | |
| MFCD00003072 | |
| benzoic acid phenyl ester, diphenylcarboxylate, benzoic acid, phenyl ester, benzoic acid phenyl, phenylbenzoate, unii-b8a3wvz590, phenol, benzoate, dsstox_cid_28185, dsstox_rid_82744, dsstox_gsid_48210 | |
| C1=CC=C(C=C1)C(=O)OC2=CC=CC=C2 | |
| 198.221 | |
| CHEBI:86919 | |
| ≥99.0% (GC) | |
| Phenyl Benzoate |
Safety and Handling
EINECSNumber : (3)-1355
RTECSNumber : DH6299500
TSCA : Yes