missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Phenyl p-Toluenesulfonate 99.0+%, TCI America™
Supplier: TCI America P023925G
Specifications
| Phenyl p-Toluenesulfonate | |
| 96°C | |
| C13H12O3S | |
| 25 g | |
| KZQFPRKQBWRRHQ-UHFFFAOYSA-N | |
| phenyl 4-methylbenzenesulfonate | |
| 223146 | |
| ≥99.0% (GC) |
| 640-60-8 | |
| White | |
| MFCD00025996 | |
| phenyl para-toluenesulfonate, p-toluenesulfonic acid phenyl ester, phenyl tosylate, phenyl p-toluenesulfonate, phenylp-toluenesulfonate, acmc-209njz, phenyl 4-methylbenzene-1-sulfonate, toluene-4-sulfonic acid phenyl ester, benzenesulfonic acid,4-methyl-, phenyl ester | |
| CC1=CC=C(C=C1)S(=O)(=O)OC2=CC=CC=C2 | |
| 248.296 | |
| 248.30 | |
| Crystalline Powder |
Chemical Identifiers
| 640-60-8 | |
| 248.296 | |
| KZQFPRKQBWRRHQ-UHFFFAOYSA-N | |
| 223146 | |
| CC1=CC=C(C=C1)S(=O)(=O)OC2=CC=CC=C2 |
| C13H12O3S | |
| MFCD00025996 | |
| phenyl para-toluenesulfonate, p-toluenesulfonic acid phenyl ester, phenyl tosylate, phenyl p-toluenesulfonate, phenylp-toluenesulfonate, acmc-209njz, phenyl 4-methylbenzene-1-sulfonate, toluene-4-sulfonic acid phenyl ester, benzenesulfonic acid,4-methyl-, phenyl ester | |
| phenyl 4-methylbenzenesulfonate |
Safety and Handling
EINECSNumber : (3)-4062
TSCA : No