missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Phenyl Salicylate 98.0+%, TCI America™
Supplier: TCI America S001725G
Specifications
| Phenyl Salicylate | |
| 44°C | |
| 173°C | |
| MFCD00002213 | |
| phenyl salicylate, salol, phenol salicylate, salphenyl, musol, 2-phenoxycarbonylphenol, benzoic acid, 2-hydroxy-, phenyl ester, salicylic acid, phenyl ester, 2-hydroxybenzoic acid phenyl ester, phenyl-2-hydroxybenzoate | |
| C1=CC=C(C=C1)OC(=O)C2=CC=CC=C2O | |
| 214.22 | |
| CHEBI:34918 | |
| ≥98.0% (GC) |
| 118-55-8 | |
| White | |
| C13H10O3 | |
| 25 g | |
| ZQBAKBUEJOMQEX-UHFFFAOYSA-N | |
| phenyl 2-hydroxybenzoate | |
| 8361 | |
| 214.22 | |
| Crystalline Powder |
Chemical Identifiers
| 118-55-8 | |
| 214.22 | |
| ZQBAKBUEJOMQEX-UHFFFAOYSA-N | |
| 8361 | |
| phenyl 2-hydroxybenzoate |
| C13H10O3 | |
| MFCD00002213 | |
| phenyl salicylate, salol, phenol salicylate, salphenyl, musol, 2-phenoxycarbonylphenol, benzoic acid, 2-hydroxy-, phenyl ester, salicylic acid, phenyl ester, 2-hydroxybenzoic acid phenyl ester, phenyl-2-hydroxybenzoate | |
| CHEBI:34918 | |
| C1=CC=C(C=C1)OC(=O)C2=CC=CC=C2O |
Safety and Handling
EINECSNumber : (3)-1597
RTECSNumber : VO6125000
TSCA : Yes