missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Picric Acid, Saturated, Approximately 1.2% (w/v), Ricca Chemical
Supplier: Ricca Chemical Company 586032
Specifications
| Picric Acid | |
| 97.0,1.26 | |
| 100.0,1.31 | |
| picric acid, trinitrophenol, carbazotic acid, picronitric acid, melinite, acide picrique, phenol trinitrate, picral, nitroxanthic acid, pikrinsaeure | |
| C1=C(C=C(C(=C1[N+](=O)[O-])O)[N+](=O)[O-])[N+](=O)[O-] | |
| 2,4,6-trinitrophenol | |
| 6954 | |
| 1 L | |
| Liquid |
| 88-89-1,7732-18-5 | |
| Yellow | |
| C6H3N3O7 | |
| OXNIZHLAWKMVMX-UHFFFAOYSA-N | |
| approximately 1.2% (w/v) | |
| 229.104 | |
| CHEBI:46149 | |
| Natural Poly Bottle |
Chemical Identifiers
| 88-89-1 | |
| OXNIZHLAWKMVMX-UHFFFAOYSA-N | |
| 6954 | |
| 2,4,6-trinitrophenol |
| C6H3N3O7 | |
| picric acid, trinitrophenol, carbazotic acid, picronitric acid, melinite, acide picrique, phenol trinitrate, picral, nitroxanthic acid, pikrinsaeure | |
| CHEBI:46149 |