missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Pigment Red 254, TCI America™
Supplier: TCI America P167625G
Specifications
| Pigment Red 254 | |
| C18H10Cl2N2O2 | |
| 3,6-Bis(4-chlorophenyl)-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione | |
| ClC1=CC=C(C=C1)C1=C2C(=O)NC(=C2C(=O)N1)C1=CC=C(Cl)C=C1 | |
| 357.19 | |
| 357.19 | |
| 25 g |
| 84632-65-5 | |
| MFCD01941106 | |
| JNNHVXMCVRYTTN-UHFFFAOYSA-N | |
| 3,6-bis(4-chlorophenyl)-1H,2H,4H,5H-pyrrolo[3,4-c]pyrrole-1,4-dione | |
| 5490942 | |
| Red | |
| Crystal/Powder |
Chemical Identifiers
| 84632-65-5 | |
| 357.19 | |
| JNNHVXMCVRYTTN-UHFFFAOYSA-N | |
| 5490942 | |
| ClC1=CC=C(C=C1)C1=C2C(=O)NC(=C2C(=O)N1)C1=CC=C(Cl)C=C1 |
| C18H10Cl2N2O2 | |
| MFCD01941106 | |
| 3,6-Bis(4-chlorophenyl)-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione | |
| 3,6-bis(4-chlorophenyl)-1H,2H,4H,5H-pyrrolo[3,4-c]pyrrole-1,4-dione |
Safety and Handling
EINECSNumber : (5)-5896
TSCA : Yes