missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Pyrene (purified by sublimation) 98.0+%, TCI America™
Supplier: TCI America P20721G
Specifications
| Pyrene (purified by sublimation) | |
| 151°C | |
| C16H10 | |
| 1 g | |
| benzo def phenanthrene, pyren, beta-pyrene, .beta.-pyrene, pyren german, unii-9e0t7wfw93, ccris 1256, pyrene def phenanthrene, coal tar pitch volatiles:pyrene | |
| C1=CC2=C3C(=C1)C=CC4=CC=CC(=C43)C=C2 | |
| 202.256 | |
| CHEBI:39106 | |
| ≥98.0% (GC) |
| 129-00-0 | |
| 404°C | |
| MFCD00004136 | |
| 2811 | |
| BBEAQIROQSPTKN-UHFFFAOYSA-N | |
| pyrene | |
| 31423 | |
| 202.26 | |
| Crystalline Powder |
Chemical Identifiers
| 129-00-0 | |
| 202.256 | |
| BBEAQIROQSPTKN-UHFFFAOYSA-N | |
| 31423 | |
| pyrene |
| C16H10 | |
| MFCD00004136 | |
| benzo def phenanthrene, pyren, beta-pyrene, .beta.-pyrene, pyren german, unii-9e0t7wfw93, ccris 1256, pyrene def phenanthrene, coal tar pitch volatiles:pyrene | |
| CHEBI:39106 | |
| C1=CC2=C3C(=C1)C=CC4=CC=CC(=C43)C=C2 |
Safety and Handling
EINECSNumber : (4)-0782
RTECSNumber : UR2450000
TSCA : Yes