missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Pyrene 97.0+%, TCI America™
$105.54 - $1256.05
Chemical Identifiers
| CAS | 129-00-0 |
|---|---|
| Molecular Formula | C16H10 |
| Molecular Weight (g/mol) | 202.256 |
| MDL Number | MFCD00004136 |
| InChI Key | BBEAQIROQSPTKN-UHFFFAOYSA-N |
| Synonym | benzo def phenanthrene, pyren, beta-pyrene, .beta.-pyrene, pyren german, unii-9e0t7wfw93, ccris 1256, pyrene def phenanthrene, coal tar pitch volatiles:pyrene |
| PubChem CID | 31423 |
| ChEBI | CHEBI:39106 |
| IUPAC Name | pyrene |
| SMILES | C1=CC2=C3C(=C1)C=CC4=CC=CC(=C43)C=C2 |
Chemical Identifiers
| 129-00-0 | |
| 202.256 | |
| BBEAQIROQSPTKN-UHFFFAOYSA-N | |
| 31423 | |
| pyrene |
| C16H10 | |
| MFCD00004136 | |
| benzo def phenanthrene, pyren, beta-pyrene, .beta.-pyrene, pyren german, unii-9e0t7wfw93, ccris 1256, pyrene def phenanthrene, coal tar pitch volatiles:pyrene | |
| CHEBI:39106 | |
| C1=CC2=C3C(=C1)C=CC4=CC=CC(=C43)C=C2 |
Specifications
| 129-00-0 | |
| 404°C | |
| MFCD00004136 | |
| 2811 | |
| BBEAQIROQSPTKN-UHFFFAOYSA-N | |
| pyrene | |
| 31423 | |
| 202.26 | |
| Crystalline Powder |
| 150°C | |
| C16H10 | |
| 25 g | |
| benzo def phenanthrene, pyren, beta-pyrene, .beta.-pyrene, pyren german, unii-9e0t7wfw93, ccris 1256, pyrene def phenanthrene, coal tar pitch volatiles:pyrene | |
| C1=CC2=C3C(=C1)C=CC4=CC=CC(=C43)C=C2 | |
| 202.256 | |
| CHEBI:39106 | |
| ≥97.0% (GC) | |
| Pyrene |
Safety and Handling
EINECSNumber : (4)-0782
RTECSNumber : UR2450000
TSCA : Yes