missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Safranin, 1% (w/v) Aqueous, Certified, LabChem™
$39.41 - $83.00
Chemical Identifiers
| CAS | 477-73-6 |
|---|---|
| Molecular Formula | C20H19ClN4 |
| Molecular Weight (g/mol) | 350.85 |
| MDL Number | MFCD00011759 |
| InChI Key | QRYAEWIQIBAZOJ-UHFFFAOYSA-N |
| Synonym | basic red 2, safranine o, gossypimine, safranin, safranine t, safranin o, safranin t, safranine, tolusafranine, hidaco safranine |
| PubChem CID | 2723800 |
| IUPAC Name | 2,7-diamino-1,8-dimethyl-5-phenyl-5λâµ-phenazin-5-ylium chloride |
| SMILES | [Cl-].CC1=C(N)C=C2C(=C1)N=C1C(C)=C(N)C=CC1=[N+]2C1=CC=CC=C1 |
Chemical Identifiers
| 477-73-6 | |
| 350.85 | |
| QRYAEWIQIBAZOJ-UHFFFAOYSA-N | |
| 2723800 | |
| [Cl-].CC1=C(N)C=C2C(=C1)N=C1C(C)=C(N)C=CC1=[N+]2C1=CC=CC=C1 |
| C20H19ClN4 | |
| MFCD00011759 | |
| basic red 2, safranine o, gossypimine, safranin, safranine t, safranin o, safranin t, safranine, tolusafranine, hidaco safranine | |
| 2,7-diamino-1,8-dimethyl-5-phenyl-5λâµ-phenazin-5-ylium chloride |
Specifications
| 477-73-6,7732-18-5 | |
| Red | |
| Poly Bottle | |
| C20H19ClN4 | |
| 125 mL | |
| basic red 2, safranine o, gossypimine, safranin, safranine t, safranin o, safranin t, safranine, tolusafranine, hidaco safranine | |
| QRYAEWIQIBAZOJ-UHFFFAOYSA-N | |
| 2,7-diamino-1,8-dimethyl-5-phenyl-5λâµ-phenazin-5-ylium chloride | |
| 2723800 | |
| Certified | |
| Safranin, 1% (w/v) Aqueous |
| 99,1 | |
| 1g/mL | |
| C20H19ClN4 | |
| MFCD00011759 | |
| 1g/mL | |
| Soluble in water | |
| [Cl-].CC1=C(N)C=C2C(=C1)N=C1C(C)=C(N)C=CC1=[N+]2C1=CC=CC=C1 | |
| 350.85 | |
| 350.85 | |
| Liquid |
Safety and Handling
GHS H Statement
Causes serious eye irritation.
GHS P Statement
Wear protective gloves, eye protection.
Wash exposed skin thoroughly after handling.
If in eyes: Rinse cautiously with water for several minutes.
Remove contact lenses, if present and easy to do.
Continue rinsing.
If eye irritation persists: Get medical advice/attention.
Warning
Recommended Storage : Room Temperature