missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Silicone Oil, For oil baths up to 250°C, MilliporeSigma™
Supplier: Technidata 1077421000
Specifications
| >250°C (1013hPa) | |
| Colorless | |
| Liquid | |
| C16H22O2Si2 | |
| diphenyl-dimethylsiloxane copolymer, polydimethyl-diphenylsiloxane, viscosity 400cst. | |
| CO[Si](C)(C)O[Si](C)(C1=CC=CC=C1)C2=CC=CC=C2 | |
| 302.52 | |
| Plastic Bottle | |
| 1.04g/3 (20°C) |
| Sillicone | |
| 68083-14-7 | |
| 1000 mL | |
| 315°C | |
| ARWRSWALIGRKQA-UHFFFAOYSA-N | |
| methoxy-dimethyl-[methyl(diphenyl)silyl]oxysilane | |
| 121233058 | |
| 47 hPa (20°C) |
Chemical Identifiers
| 68083-14-7 | |
| 302.52 | |
| diphenyl-dimethylsiloxane copolymer, polydimethyl-diphenylsiloxane, viscosity 400cst. | |
| methoxy-dimethyl-[methyl(diphenyl)silyl]oxysilane |
| C16H22O2Si2 | |
| ARWRSWALIGRKQA-UHFFFAOYSA-N | |
| 121233058 | |
| CO[Si](C)(C)O[Si](C)(C1=CC=CC=C1)C2=CC=CC=C2 |
Safety and Handling
RTECSNumber : VW3146875