missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Sodium oxalate, For ACS analysis, 99.96%, MP Biomedicals™
$116.25 - $116.25
Chemical Identifiers
| CAS | 62-76-0 |
|---|---|
| Molecular Formula | C2Na2O4 |
| Molecular Weight (g/mol) | 134 |
| MDL Number | MFCD00012465 |
| InChI Key | ZNCPFRVNHGOPAG-UHFFFAOYSA-L |
| Synonym | sodium oxalate, disodium oxalate, natriumoxalat, ethanedioic acid, disodium salt, oxalic acid, disodium salt, natriumoxalat german, stavelan sodny czech, oxalic acid disodium salt, unii-7u0v68lt9x, ethanedioic acid disodium salt |
| PubChem CID | 6125 |
| IUPAC Name | disodium oxalate |
| SMILES | [Na+].[Na+].[O-]C(=O)C([O-])=O |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
ICN19143980
|
MP Biomedicals Inc
0219143980 |
100 g |
Each for $116.25
|
|
|||||
Chemical Identifiers
| 62-76-0 | |
| 134 | |
| ZNCPFRVNHGOPAG-UHFFFAOYSA-L | |
| 6125 | |
| [Na+].[Na+].[O-]C(=O)C([O-])=O |
| C2Na2O4 | |
| MFCD00012465 | |
| sodium oxalate, disodium oxalate, natriumoxalat, ethanedioic acid, disodium salt, oxalic acid, disodium salt, natriumoxalat german, stavelan sodny czech, oxalic acid disodium salt, unii-7u0v68lt9x, ethanedioic acid disodium salt | |
| disodium oxalate |
Specifications
| 62-76-0 | |
| 2.34 (water = 1) | |
| C2Na2O4 | |
| 100 g | |
| ZNCPFRVNHGOPAG-UHFFFAOYSA-L | |
| disodium oxalate | |
| 6125 | |
| Crystalline Powder |
| White | |
| 0.9996 | |
| MFCD00012465 | |
| sodium oxalate, disodium oxalate, natriumoxalat, ethanedioic acid, disodium salt, oxalic acid, disodium salt, natriumoxalat german, stavelan sodny czech, oxalic acid disodium salt, unii-7u0v68lt9x, ethanedioic acid disodium salt | |
| [Na+].[Na+].[O-]C(=O)C([O-])=O | |
| 134 | |
| 134 | |
| Sodium oxalate, For ACS analysis |