missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Sodium Salicylate (Powder/Certified), Fisher Chemical
Supplier: Thermo Fisher Scientific S395500
Specifications
| Sodium Salicylate | |
| 200°C | |
| ≥99.5 % | |
| C7H5NaO3 | |
| MFCD00002440 | |
| sodium salicylate, sodium 2-hydroxybenzoate, salsonin, clin, enterosalicyl, enterosalil, entrosalyl, glutosalyl, kerasalicyl, magsalyl | |
| ABBQHOQBGMUPJH-UHFFFAOYSA-M | |
| sodium;2-hydroxybenzoate | |
| 16760658 | |
| 160.1 | |
| Certified |
| 54-21-7 | |
| White | |
| Glass Bottle | |
| 2-HOC6H4COONa | |
| 500 g | |
| 0.005% max. Insoluble Matter | |
| C1=CC=C(C(=C1)C(=O)[O-])O.[Na+] | |
| 160.104 | |
| CHEBI:9180 | |
| ≥99.5% | |
| Solid |
Chemical Identifiers
| 54-21-7 | |
| 160.104 | |
| ABBQHOQBGMUPJH-UHFFFAOYSA-M | |
| 16760658 | |
| sodium;2-hydroxybenzoate |
| C7H5NaO3 | |
| MFCD00002440 | |
| sodium salicylate, sodium 2-hydroxybenzoate, salsonin, clin, enterosalicyl, enterosalil, entrosalyl, glutosalyl, kerasalicyl, magsalyl | |
| CHEBI:9180 | |
| C1=CC=C(C(=C1)C(=O)[O-])O.[Na+] |
Safety and Handling