missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Starch, Extracted from Potato, MP Biomedicals™
Starch is used as an additive for food processing, food starches are typically used as thickeners and stabilizers
Supplier: MP Biomedicals Inc 0210295402
Specifications
| Starch | |
| 9005-25-8 | |
| MFCD00082026,MFCD00132834 | |
| 2 kg | |
| OCC1OC(OC2C(O)C(O)C(O)OC2CO)C(O)C(O)C1O | |
| 342.30 | |
| CHEBI:18167 |
| Powder | |
| C12H22O11 | |
| alpha-maltose, maltose, starch, soluble, glcalpha1-4glca, unii-15sug9ad26, glcalpha1-4glcalpha, amylodextrin, starch solution, alpha-malt sugar, 4-o-alpha-d-glucopyranosyl-alpha-d-glucopyranose | |
| GUBGYTABKSRVRQ-UHFFFAOYNA-N | |
| 2-(hydroxymethyl)-6-{[4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy}oxane-3,4,5-triol | |
| 439341 |
Chemical Identifiers
| 9005-25-8 | |
| 342.30 | |
| GUBGYTABKSRVRQ-UHFFFAOYNA-N | |
| 439341 | |
| 2-(hydroxymethyl)-6-{[4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy}oxane-3,4,5-triol |
| C12H22O11 | |
| MFCD00082026,MFCD00132834 | |
| alpha-maltose, maltose, starch, soluble, glcalpha1-4glca, unii-15sug9ad26, glcalpha1-4glcalpha, amylodextrin, starch solution, alpha-malt sugar, 4-o-alpha-d-glucopyranosyl-alpha-d-glucopyranose | |
| CHEBI:18167 | |
| OCC1OC(OC2C(O)C(O)C(O)OC2CO)C(O)C(O)C1O |
Safety and Handling
EINECSNumber : 232-679-6