missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Succinyl sulfathiazole, 99.48%, MP Biomedicals™
Succinylsulfathiazole is used to block the synthesis of folic acid. It is used to study folate deficiency
Supplier: MP Biomedicals Inc 0210297690
Specifications
| Succinyl sulfathiazole | |
| White | |
| MFCD00022437 | |
| succinylsulfathiazole, cremosuxidine, sulfasuccidine, sulfasuccinil, sulfasuxidine, colistatin, sulfadigesin, sulfasuccithiazole, sulfasuccidin, sulfenterone | |
| C1=CC(=CC=C1NC(=O)CCC(=O)O)S(=O)(=O)NC2=NC=CS2 | |
| 355.383 | |
| CHEBI:9309 | |
| Powder |
| 116-43-8 | |
| C13H13N3O5S2 | |
| 500 g | |
| SKVLYVHULOWXTD-UHFFFAOYSA-N | |
| 4-oxo-4-[4-(1,3-thiazol-2-ylsulfamoyl)anilino]butanoic acid | |
| 5315 | |
| 355.4 |
Chemical Identifiers
| 116-43-8 | |
| 355.383 | |
| SKVLYVHULOWXTD-UHFFFAOYSA-N | |
| 5315 | |
| 4-oxo-4-[4-(1,3-thiazol-2-ylsulfamoyl)anilino]butanoic acid |
| C13H13N3O5S2 | |
| MFCD00022437 | |
| succinylsulfathiazole, cremosuxidine, sulfasuccidine, sulfasuccinil, sulfasuxidine, colistatin, sulfadigesin, sulfasuccithiazole, sulfasuccidin, sulfenterone | |
| CHEBI:9309 | |
| C1=CC(=CC=C1NC(=O)CCC(=O)O)S(=O)(=O)NC2=NC=CS2 |
Safety and Handling
EINECSNumber : 204-141-0