missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
(tert-Butoxycarbonylmethyl)triphenylphosphonium Bromide 98.0+%, TCI America™
Supplier: TCI America B392825G
Specifications
| (tert-Butoxycarbonylmethyl)triphenylphosphonium Bromide | |
| 176°C | |
| C24H26BrO2P | |
| 25 g | |
| ZGLFRTJDWWKIAK-UHFFFAOYSA-M | |
| [2-(tert-butoxy)-2-oxoethyl]triphenylphosphanium bromide | |
| 2733853 | |
| ≥98.0% (HPLC,T) |
| 59159-39-6 | |
| White | |
| MFCD00075527 | |
| tert-butoxycarbonylmethyl triphenylphosphonium bromide, tert-butoxycarbonylmethyl triphenylphosphanium bromide, 2-tert-butoxy-2-oxoethyl triphenylphosphonium bromide, phosphonium, 2-1,1-dimethylethoxy-2-oxoethyl triphenyl-, bromide, 2-tert-butoxy-2-oxoethyl triphenylphosphanium bromide, acmc-20apek, ksc609k1l, carbo-t-butoxymethyl triphenylphosphonium bromide, tert-butoxy carbonyl methyl triphenyl phosphoniu | |
| [Br-].CC(C)(C)OC(=O)C[P+](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 | |
| 457.35 | |
| 457.35 | |
| Crystalline Powder |
Chemical Identifiers
| 59159-39-6 | |
| 457.35 | |
| ZGLFRTJDWWKIAK-UHFFFAOYSA-M | |
| 2733853 | |
| [Br-].CC(C)(C)OC(=O)C[P+](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| C24H26BrO2P | |
| MFCD00075527 | |
| tert-butoxycarbonylmethyl triphenylphosphonium bromide, tert-butoxycarbonylmethyl triphenylphosphanium bromide, 2-tert-butoxy-2-oxoethyl triphenylphosphonium bromide, phosphonium, 2-1,1-dimethylethoxy-2-oxoethyl triphenyl-, bromide, 2-tert-butoxy-2-oxoethyl triphenylphosphanium bromide, acmc-20apek, ksc609k1l, carbo-t-butoxymethyl triphenylphosphonium bromide, tert-butoxy carbonyl methyl triphenyl phosphoniu | |
| [2-(tert-butoxy)-2-oxoethyl]triphenylphosphanium bromide |
Safety and Handling
TSCA : No