missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Tetrabutylammonium Azide 95.0+%, TCI America™
Supplier: TCI America T09205G
Specifications
| Tetrabutylammonium Azide | |
| 85°C | |
| C16H36N4 | |
| 5 g | |
| GMRIOAVKKGNMMV-UHFFFAOYSA-N | |
| tetrabutylazanium;azide | |
| 5743232 | |
| ≥95.0% (T) |
| 993-22-6 | |
| White-Yellow | |
| MFCD00060069 | |
| 2811 | |
| CCCC[N+](CCCC)(CCCC)CCCC.[N-]=[N+]=[N-] | |
| 284.492 | |
| 284.49 | |
| Crystalline Powder |
Chemical Identifiers
| 993-22-6 | |
| 284.492 | |
| GMRIOAVKKGNMMV-UHFFFAOYSA-N | |
| tetrabutylazanium;azide |
| C16H36N4 | |
| MFCD00060069 | |
| 5743232 | |
| CCCC[N+](CCCC)(CCCC)CCCC.[N-]=[N+]=[N-] |
Safety and Handling
EINECSNumber : (2)-0186
TSCA : Yes
Recommended Storage : Refrigerator