missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Tetrabutylammonium Phosphate (White to Off-White Powder/HPLC Grade), Fisher Chemical™
Improve HPLC separation of acidic analytes by ion pairing.
Supplier: Thermo Fisher Scientific O6117100
Description
- High purity
- Application tested
- Dissolves easily
Specifications
| Tetrabutylammonium Phosphate | |
| 0.02 AU max. at 214nm, 0.1 AU max. at 210nm, 0.2 AU max. at 200nm | |
| White | |
| ≥98.5 % | |
| (CH3CH2CH2CH2)4NH2PO4 | |
| 100 g | |
| OP(O)([O-])=O.CCCC[N+](CCCC)(CCCC)CCCC | |
| 339.46 | |
| 339.45 | |
| HPLC |
| 5574-97-0 | |
| 148°C | |
| 4 to 5 | |
| C16H38NO4P | |
| MFCD00064526 | |
| ARRNBPCNZJXHRJ-UHFFFAOYSA-M | |
| tetrabutylazanium dihydrogen phosphate | |
| 2735142 | |
| ≥98.5% | |
| Powder or Solid |
Chemical Identifiers
| 5574-97-0 | |
| 339.46 | |
| ARRNBPCNZJXHRJ-UHFFFAOYSA-M | |
| tetrabutylazanium dihydrogen phosphate |
| C16H38NO4P | |
| MFCD00064526 | |
| 2735142 | |
| OP(O)([O-])=O.CCCC[N+](CCCC)(CCCC)CCCC |
Safety and Handling