missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Thiamine Hydrochloride Hydrate 98.0+%, TCI America™
$63.57 - $410.67
Chemical Identifiers
| CAS | 67-03-8 |
|---|---|
| Molecular Formula | C12H18Cl2N4OS |
| Molecular Weight (g/mol) | 337.263 |
| MDL Number | MFCD00012780 |
| InChI Key | DPJRMOMPQZCRJU-UHFFFAOYSA-M |
| Synonym | thiamine hydrochloride, vitamin b1 hydrochloride, thiamine hcl, aneurine hydrochloride, berin, thiamine chloride hydrochloride, trophite, thiamin chloride, thiamine dichloride, thiaminium chloride |
| PubChem CID | 6202 |
| ChEBI | CHEBI:49105 |
| IUPAC Name | 2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethanol;chloride;hydrochloride |
| SMILES | CC1=C(SC=[N+]1CC2=CN=C(N=C2N)C)CCO.Cl.[Cl-] |
Chemical Identifiers
| 67-03-8 | |
| 337.263 | |
| DPJRMOMPQZCRJU-UHFFFAOYSA-M | |
| 6202 | |
| 2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethanol;chloride;hydrochloride |
| C12H18Cl2N4OS | |
| MFCD00012780 | |
| thiamine hydrochloride, vitamin b1 hydrochloride, thiamine hcl, aneurine hydrochloride, berin, thiamine chloride hydrochloride, trophite, thiamin chloride, thiamine dichloride, thiaminium chloride | |
| CHEBI:49105 | |
| CC1=C(SC=[N+]1CC2=CN=C(N=C2N)C)CCO.Cl.[Cl-] |
Specifications
| 67-03-8 | |
| C12H18Cl2N4OS | |
| 25 g | |
| DPJRMOMPQZCRJU-UHFFFAOYSA-M | |
| 2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethanol;chloride;hydrochloride | |
| 6202 | |
| 337.26 | |
| Crystalline Powder |
| White | |
| MFCD00012780 | |
| thiamine hydrochloride, vitamin b1 hydrochloride, thiamine hcl, aneurine hydrochloride, berin, thiamine chloride hydrochloride, trophite, thiamin chloride, thiamine dichloride, thiaminium chloride | |
| CC1=C(SC=[N+]1CC2=CN=C(N=C2N)C)CCO.Cl.[Cl-] | |
| 337.263 | |
| CHEBI:49105 | |
| ≥98.0% (HPLC,T) | |
| Thiamine Hydrochloride Hydrate |
Safety and Handling
RTECSNumber : XI7350000
TSCA : Yes