missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Toluidine Blue O (Certified Biological Stain), Fisher Chemical
For use in histology
Supplier: Thermo Fisher Scientific T16125
Specifications
| Toluidine Blue O | |
| Pass Test | |
| C15H16ClN3S | |
| Basic Blue 17, Tolonium Chloride | |
| [Cl-].CN(C)C1=CC=C2N=C3C=C(C)C(N)=CC3=[S+]C2=C1 | |
| 305.82 | |
| 305.83 | |
| Glass Bottle | |
| 52040 | |
| 25 g |
| 92-31-9 | |
| Report % | |
| MFCD00011934 | |
| HNONEKILPDHFOL-UHFFFAOYSA-M | |
| 3-amino-7-(dimethylamino)-2-methyl-5λâ´-phenothiazin-5-ylium chloride | |
| 7083 | |
| Certified Biological Stain | |
| Vapor Pressure: Negligible | |
| Green | |
| Solid |
Chemical Identifiers
| 92-31-9 | |
| 305.82 | |
| HNONEKILPDHFOL-UHFFFAOYSA-M | |
| 7083 | |
| [Cl-].CN(C)C1=CC=C2N=C3C=C(C)C(N)=CC3=[S+]C2=C1 |
| C15H16ClN3S | |
| MFCD00011934 | |
| Basic Blue 17, Tolonium Chloride | |
| 3-amino-7-(dimethylamino)-2-methyl-5λâ´-phenothiazin-5-ylium chloride |
Safety and Handling
WARNING!
Emergency Overview
Harmful if swallowed. Use personal protective equipment. Ensure adequate ventilation. Wash off immediately with plenty of water for at least 15 minutes. Get medical attention immediately if symptoms occur. Rinse immediately with plenty of water, also under the eyelids, for at least 15 minutes. Obtain medical attention. Move to fresh air. If breathing is difficult, give oxygen. Do not use mouth-to-mouth resuscitation if victim ingested or inhaled the substance; induce artifici. Get medical attention immediately if symptoms occur. Rinse mouth. Rinse mouth. Drink plenty of water.
NFPA
Health:2
Flammability:1
Instability:0