missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Tri(p-tolyl)phosphine 96.0+%, TCI America™
$65.17 - $193.56
Chemical Identifiers
| CAS | 1038-95-5 |
|---|---|
| Molecular Formula | C21H21P |
| Molecular Weight (g/mol) | 304.37 |
| MDL Number | MFCD00008542 |
| InChI Key | WXAZIUYTQHYBFW-UHFFFAOYSA-N |
| Synonym | tri-p-tolylphosphine, tris 4-methylphenyl phosphine, tri p-tolyl phosphine, phosphine, tris 4-methylphenyl, tri-para-tolylphosphine, tris p-tolyl phosphine, phosphine, tri-p-tolyl, tris 4-methylphenyl phosphane, phosphine, tris p-tolyl, tri-p-tolyl phosphine |
| PubChem CID | 13956 |
| IUPAC Name | tris(4-methylphenyl)phosphane |
| SMILES | CC1=CC=C(C=C1)P(C1=CC=C(C)C=C1)C1=CC=C(C)C=C1 |
Chemical Identifiers
| 1038-95-5 | |
| 304.37 | |
| WXAZIUYTQHYBFW-UHFFFAOYSA-N | |
| 13956 | |
| CC1=CC=C(C=C1)P(C1=CC=C(C)C=C1)C1=CC=C(C)C=C1 |
| C21H21P | |
| MFCD00008542 | |
| tri-p-tolylphosphine, tris 4-methylphenyl phosphine, tri p-tolyl phosphine, phosphine, tris 4-methylphenyl, tri-para-tolylphosphine, tris p-tolyl phosphine, phosphine, tri-p-tolyl, tris 4-methylphenyl phosphane, phosphine, tris p-tolyl, tri-p-tolyl phosphine | |
| tris(4-methylphenyl)phosphane |
Specifications
| 1038-95-5 | |
| White | |
| MFCD00008542 | |
| tri-p-tolylphosphine, tris 4-methylphenyl phosphine, tri p-tolyl phosphine, phosphine, tris 4-methylphenyl, tri-para-tolylphosphine, tris p-tolyl phosphine, phosphine, tri-p-tolyl, tris 4-methylphenyl phosphane, phosphine, tris p-tolyl, tri-p-tolyl phosphine | |
| CC1=CC=C(C=C1)P(C1=CC=C(C)C=C1)C1=CC=C(C)C=C1 | |
| 304.37 | |
| 304.37 | |
| Crystalline Powder |
| 149°C | |
| C21H21P | |
| 5 g | |
| WXAZIUYTQHYBFW-UHFFFAOYSA-N | |
| tris(4-methylphenyl)phosphane | |
| 13956 | |
| ≥96.0% (GC) | |
| Tri(p-tolyl)phosphine |
Safety and Handling
RTECSNumber : SZ3880000
TSCA : Yes