missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Specifications
| Triacetin | |
| -78°C | |
| 260°C | |
| MFCD00008716 | |
| triacetin, glyceryl triacetate, glycerol triacetate, glycerin triacetate, enzactin, triacetine, triacetylglycerol, fungacetin, glyped, triacetyl glycerine | |
| CC(=O)OCC(COC(=O)C)OC(=O)C | |
| 218.205 | |
| CHEBI:9661 | |
| ≥99.0% (GC) |
| 102-76-1 | |
| Colorless | |
| C9H14O6 | |
| 500 g | |
| URAYPUMNDPQOKB-UHFFFAOYSA-N | |
| 2,3-diacetyloxypropyl acetate | |
| 5541 | |
| 218.21 | |
| Liquid |
Chemical Identifiers
| 102-76-1 | |
| 218.205 | |
| URAYPUMNDPQOKB-UHFFFAOYSA-N | |
| 5541 | |
| 2,3-diacetyloxypropyl acetate |
| C9H14O6 | |
| MFCD00008716 | |
| triacetin, glyceryl triacetate, glycerol triacetate, glycerin triacetate, enzactin, triacetine, triacetylglycerol, fungacetin, glyped, triacetyl glycerine | |
| CHEBI:9661 | |
| CC(=O)OCC(COC(=O)C)OC(=O)C |
Safety and Handling
EINECSNumber : (2)-0666&(2)-0753
RTECSNumber : AK3675000
TSCA : Yes