missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Tridecafluoroheptanoic Acid (ca. 5mmol) 98.0+%, TCI America™
Supplier: TCI America A57161SAMPLE
Specifications
| Tridecafluoroheptanoic Acid (ca. 5mmol) [Ion-Pair Reagent for LC-MS] | |
| White-Yellow | |
| C7HF13O2 | |
| Set | |
| perfluoroheptanoic acid, tridecafluoroheptanoic acid, perfluoroenanthic acid, perfluoro-n-heptanoic acid, heptanoic acid, tridecafluoro, tridecafluoro-1-heptanoic acid, heptanoic acid, 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro, n-perfluoroheptanoic acid, tridecafluoroenanthic acid, acmc-1agq8 | |
| C(=O)(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O | |
| 364.062 | |
| CHEBI:35547 | |
| ≥98.0% (T) |
| 375-85-9 | |
| 177°C | |
| MFCD00039604 | |
| 3261 | |
| ZWBAMYVPMDSJGQ-UHFFFAOYSA-N | |
| 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoic acid | |
| 67818 | |
| 364.06 | |
| Crystals |
Chemical Identifiers
| 375-85-9 | |
| 364.062 | |
| ZWBAMYVPMDSJGQ-UHFFFAOYSA-N | |
| 67818 | |
| 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoic acid |
| C7HF13O2 | |
| MFCD00039604 | |
| perfluoroheptanoic acid, tridecafluoroheptanoic acid, perfluoroenanthic acid, perfluoro-n-heptanoic acid, heptanoic acid, tridecafluoro, tridecafluoro-1-heptanoic acid, heptanoic acid, 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro, n-perfluoroheptanoic acid, tridecafluoroenanthic acid, acmc-1agq8 | |
| CHEBI:35547 | |
| C(=O)(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O |
Safety and Handling
EINECSNumber : (2)-1182&(2)-2659
TSCA : Yes