missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Tridecafluoroheptanoic Acid High Grade 98.0+%, TCI America™
$175.78 - $521.40
Chemical Identifiers
| CAS | 375-85-9 |
|---|---|
| Molecular Formula | C7HF13O2 |
| Molecular Weight (g/mol) | 364.062 |
| MDL Number | MFCD00039604 |
| InChI Key | ZWBAMYVPMDSJGQ-UHFFFAOYSA-N |
| Synonym | perfluoroheptanoic acid, tridecafluoroheptanoic acid, perfluoroenanthic acid, perfluoro-n-heptanoic acid, heptanoic acid, tridecafluoro, tridecafluoro-1-heptanoic acid, heptanoic acid, 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro, n-perfluoroheptanoic acid, tridecafluoroenanthic acid, acmc-1agq8 |
| PubChem CID | 67818 |
| ChEBI | CHEBI:35547 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoic acid |
| SMILES | C(=O)(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O |
Chemical Identifiers
| 375-85-9 | |
| 364.062 | |
| ZWBAMYVPMDSJGQ-UHFFFAOYSA-N | |
| 67818 | |
| 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoic acid |
| C7HF13O2 | |
| MFCD00039604 | |
| perfluoroheptanoic acid, tridecafluoroheptanoic acid, perfluoroenanthic acid, perfluoro-n-heptanoic acid, heptanoic acid, tridecafluoro, tridecafluoro-1-heptanoic acid, heptanoic acid, 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro, n-perfluoroheptanoic acid, tridecafluoroenanthic acid, acmc-1agq8 | |
| CHEBI:35547 | |
| C(=O)(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O |
Specifications
| 375-85-9 | |
| 177°C | |
| MFCD00039604 | |
| 3261 | |
| ZWBAMYVPMDSJGQ-UHFFFAOYSA-N | |
| 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoic acid | |
| 67818 | |
| 364.06 | |
| Crystalline Powder |
| White | |
| C7HF13O2 | |
| 1 g | |
| perfluoroheptanoic acid, tridecafluoroheptanoic acid, perfluoroenanthic acid, perfluoro-n-heptanoic acid, heptanoic acid, tridecafluoro, tridecafluoro-1-heptanoic acid, heptanoic acid, 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro, n-perfluoroheptanoic acid, tridecafluoroenanthic acid, acmc-1agq8 | |
| C(=O)(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O | |
| 364.062 | |
| CHEBI:35547 | |
| ≥98.0% (T) | |
| Tridecafluoroheptanoic Acid High Grade [Ion-Pair Reagent for LC-MS] |
Safety and Handling
EINECSNumber : (2)-1182&(2)-2659
TSCA : Yes