missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Triphenylmethane, 98%
CAS: 519-73-3 | C19H16 | 244.34 g/mol
$64.96 - $693.77
Chemical Identifiers
| CAS | 519-73-3 |
|---|---|
| Molecular Formula | C19H16 |
| Molecular Weight (g/mol) | 244.34 |
| MDL Number | MFCD00004763 |
| InChI Key | AAAQKTZKLRYKHR-UHFFFAOYSA-N |
| Synonym | triphenylmethane, tritane, benzene, 1,1',1-methylidynetris, methane, triphenyl, diphenylmethyl benzene, 1,1',1-methanetriyltribenzene, unii-8o4utw9e17, ccris 5194, triphenyl methane, triphenylmethane? |
| PubChem CID | 10614 |
| ChEBI | CHEBI:76212 |
| IUPAC Name | benzhydrylbenzene |
| SMILES | C1=CC=C(C=C1)C(C1=CC=CC=C1)C1=CC=CC=C1 |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AAA1171014
|
Thermo Scientific Chemicals
A1171014 |
25 g |
Each for $64.96
|
|
|||||
|
AAA1171022
|
Thermo Scientific Chemicals
A1171022 |
100 g |
Each for $151.99
|
|
|||||
|
AAA1171036
|
Thermo Scientific Chemicals
A1171036 |
500 g |
Each for $693.77
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 519-73-3 | |
| 244.34 | |
| AAAQKTZKLRYKHR-UHFFFAOYSA-N | |
| 10614 | |
| benzhydrylbenzene |
| C19H16 | |
| MFCD00004763 | |
| triphenylmethane, tritane, benzene, 1,1',1-methylidynetris, methane, triphenyl, diphenylmethyl benzene, 1,1',1-methanetriyltribenzene, unii-8o4utw9e17, ccris 5194, triphenyl methane, triphenylmethane? | |
| CHEBI:76212 | |
| C1=CC=C(C=C1)C(C1=CC=CC=C1)C1=CC=CC=C1 |
Specifications
| 519-73-3 | |
| 1.01 | |
| C19H16 | |
| 25 g | |
| 14,9741 | |
| AAAQKTZKLRYKHR-UHFFFAOYSA-N | |
| benzhydrylbenzene | |
| 10614 | |
| 244.34 | |
| Triphenylmethane |
| 92°C to 94°C | |
| 358°C to 359°C | |
| MFCD00004763 | |
| 1909753 | |
| triphenylmethane, tritane, benzene, 1,1',1-methylidynetris, methane, triphenyl, diphenylmethyl benzene, 1,1',1-methanetriyltribenzene, unii-8o4utw9e17, ccris 5194, triphenyl methane, triphenylmethane? | |
| C1=CC=C(C=C1)C(C1=CC=CC=C1)C1=CC=CC=C1 | |
| 244.34 | |
| CHEBI:76212 | |
| 98% |
Safety and Handling
EINECSNumber : 208-275-0
TSCA : Yes
Recommended Storage : Ambient temperatures
RUO – Research Use Only