missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Triphenylmethane, 99+%
CAS: 519-73-3 | C19H16 | 244.34 g/mol
$67.38 - $67.38
Chemical Identifiers
| CAS | 519-73-3 |
|---|---|
| Molecular Formula | C19H16 |
| Molecular Weight (g/mol) | 244.34 |
| MDL Number | MFCD00004763 |
| InChI Key | AAAQKTZKLRYKHR-UHFFFAOYSA-N |
| Synonym | triphenylmethane, tritane, benzene, 1,1',1-methylidynetris, methane, triphenyl, diphenylmethyl benzene, 1,1',1-methanetriyltribenzene, unii-8o4utw9e17, ccris 5194, triphenyl methane, triphenylmethane? |
| PubChem CID | 10614 |
| ChEBI | CHEBI:76212 |
| IUPAC Name | benzhydrylbenzene |
| SMILES | C1=CC=C(C=C1)C(C1=CC=CC=C1)C1=CC=CC=C1 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC146380250
|
Thermo Scientific Chemicals
146380250 |
25 g | Glass bottle |
Each for $67.38
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 519-73-3 | |
| 244.34 | |
| AAAQKTZKLRYKHR-UHFFFAOYSA-N | |
| 10614 | |
| benzhydrylbenzene |
| C19H16 | |
| MFCD00004763 | |
| triphenylmethane, tritane, benzene, 1,1',1-methylidynetris, methane, triphenyl, diphenylmethyl benzene, 1,1',1-methanetriyltribenzene, unii-8o4utw9e17, ccris 5194, triphenyl methane, triphenylmethane? | |
| CHEBI:76212 | |
| C1=CC=C(C=C1)C(C1=CC=CC=C1)C1=CC=CC=C1 |
Specifications
| 519-73-3 | |
| Yellow | |
| 358.0°C to 359.0°C (754.0 mmHg) | |
| 99% min. (GC) | |
| C19H16 | |
| MFCD00004763 | |
| 05,698 | |
| 15,9914 | |
| Solubility in water: insoluble in water | |
| C1=CC=C(C=C1)C(C1=CC=CC=C1)C1=CC=CC=C1 | |
| 244.34 | |
| CHEBI:76212 | |
| 99+% | |
| Triphenylmethane, 99+% |
| 90.0°C to 94.0°C | |
| 1.0100g/mL | |
| Authentic | |
| Glass bottle | |
| (C6H5)3CH | |
| 25 g | |
| 1.01 | |
| triphenylmethane, tritane, benzene, 1,1',1-methylidynetris, methane, triphenyl, diphenylmethyl benzene, 1,1',1-methanetriyltribenzene, unii-8o4utw9e17, ccris 5194, triphenyl methane, triphenylmethane? | |
| AAAQKTZKLRYKHR-UHFFFAOYSA-N | |
| benzhydrylbenzene | |
| 10614 | |
| 244.34 | |
| Powder |
Safety and Handling
EINECSNumber : 208-275-0
TSCA : TSCA
RUO – Research Use Only