missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Tris(2,4-di-tert-butylphenyl) Phosphite 98.0+%, TCI America™
Supplier: TCI America P142125G
Specifications
| Tris(2,4-di-tert-butylphenyl) Phosphite | |
| 187°C | |
| C42H63O3P | |
| 25 g | |
| JKIJEFPNVSHHEI-UHFFFAOYSA-N | |
| tris(2,4-ditert-butylphenyl) phosphite | |
| 91601 | |
| ≥98.0% (GC) |
| 31570-04-4 | |
| White | |
| MFCD00072706 | |
| Phosphorous Acid Tris(2,4-di-tert-butylphenyl) Ester | |
| CC(C)(C)C1=CC(=C(C=C1)OP(OC2=C(C=C(C=C2)C(C)(C)C)C(C)(C)C)OC3=C(C=C(C=C3)C(C)(C)C)C(C)(C)C)C(C)(C)C | |
| 646.937 | |
| 646.94 | |
| Crystalline Powder |
Chemical Identifiers
| 31570-04-4 | |
| 646.937 | |
| JKIJEFPNVSHHEI-UHFFFAOYSA-N | |
| 91601 | |
| CC(C)(C)C1=CC(=C(C=C1)OP(OC2=C(C=C(C=C2)C(C)(C)C)C(C)(C)C)OC3=C(C=C(C=C3)C(C)(C)C)C(C)(C)C)C(C)(C)C |
| C42H63O3P | |
| MFCD00072706 | |
| Phosphorous Acid Tris(2,4-di-tert-butylphenyl) Ester | |
| tris(2,4-ditert-butylphenyl) phosphite |
Safety and Handling
EINECSNumber : (3)-3510
TSCA : Yes