missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
MilliporeSigma™ Triton X-100 Detergent, Molecular biology grade, Calbiochem™,
Supplier: MilliporeSigma™ 64846650ML
Specifications
| Undesignated | |
| 6.0 to 8.0 | |
| Plastic Ampoule | |
| MFCD00132505 | |
| JYCQQPHGFMYQCF-UHFFFAOYSA-N | |
| 2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethan-1-ol | |
| 5590 |
| 9002-93-1 | |
| 50 mL | |
| C16H26O2 | |
| Polyethylene Glycol-p-isooctylphenyl Ether | |
| CC(C)(C)CC(C)(C)C1=CC=C(OCCO)C=C1 | |
| 250.38 | |
| Molecular Biology |
Chemical Identifiers
| 9002-93-1 | |
| 250.38 | |
| JYCQQPHGFMYQCF-UHFFFAOYSA-N | |
| 5590 | |
| CC(C)(C)CC(C)(C)C1=CC=C(OCCO)C=C1 |
| C16H26O2 | |
| MFCD00132505 | |
| Polyethylene Glycol-p-isooctylphenyl Ether | |
| 2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethan-1-ol |