missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Uric acid, 99% max., MP Biomedicals™
Supplier: MP Biomedicals Inc 0210321580
Specifications
| Uric acid | |
| White | |
| 99% max. | |
| 100 g | |
| LEHOTFFKMJEONL-UHFFFAOYSA-N | |
| 7,9-dihydro-3H-purine-2,6,8-trione | |
| 1175 | |
| 168.11 |
| 69-93-2 | |
| 1.89g/mL | |
| C5H4N4O3 | |
| uric acid, urate, 2,6,8-trioxypurine, lithic acid, 2,6,8-trihydroxypurine, 2,6,8-trioxopurine, 1h-purine-2,6,8-triol, 8-hydroxyxanthine, 7,9-dihydro-1h-purine-2,6,8 3h-trione, 1h-purine-2,6,8 3h-trione, 7,9-dihydro | |
| C12=C(NC(=O)N1)NC(=O)NC2=O | |
| 168.112 | |
| CHEBI:17775 | |
| Crystalline Powder |
Chemical Identifiers
| 69-93-2 | |
| 168.112 | |
| uric acid, urate, 2,6,8-trioxypurine, lithic acid, 2,6,8-trihydroxypurine, 2,6,8-trioxopurine, 1h-purine-2,6,8-triol, 8-hydroxyxanthine, 7,9-dihydro-1h-purine-2,6,8 3h-trione, 1h-purine-2,6,8 3h-trione, 7,9-dihydro | |
| CHEBI:17775 | |
| C12=C(NC(=O)N1)NC(=O)NC2=O |
| C5H4N4O3 | |
| LEHOTFFKMJEONL-UHFFFAOYSA-N | |
| 1175 | |
| 7,9-dihydro-3H-purine-2,6,8-trione |