missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Zinc N-Ethyl-N-phenyldithiocarbamate 98.0+%, TCI America™
Supplier: TCI America E0163500G
Specifications
| Zinc N-Ethyl-N-phenyldithiocarbamate | |
| 206°C | |
| C18H20N2S4Zn | |
| 500 g | |
| KMNUDJAXRXUZQS-UHFFFAOYSA-L | |
| zinc;N-ethyl-N-phenylcarbamodithioate | |
| 6093375 | |
| ≥98.0% (T) |
| 14634-93-6 | |
| White-Yellow | |
| MFCD00059686 | |
| N-Ethyl-N-phenyldithiocarbamic Acid Zinc Salt | |
| CCN(C1=CC=CC=C1)C(=S)[S-].CCN(C1=CC=CC=C1)C(=S)[S-].[Zn+2] | |
| 457.992 | |
| 457.99 | |
| Crystalline Powder |
Chemical Identifiers
| 14634-93-6 | |
| 457.992 | |
| KMNUDJAXRXUZQS-UHFFFAOYSA-L | |
| 6093375 | |
| CCN(C1=CC=CC=C1)C(=S)[S-].CCN(C1=CC=CC=C1)C(=S)[S-].[Zn+2] |
| C18H20N2S4Zn | |
| MFCD00059686 | |
| N-Ethyl-N-phenyldithiocarbamic Acid Zinc Salt | |
| zinc;N-ethyl-N-phenylcarbamodithioate |
Safety and Handling
EINECSNumber : (3)-2186
RTECSNumber : ZH0890000
TSCA : Yes