missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
1,3-Diisopropenylbenzene (stabilized with TBC) 97.0+%, TCI America™
Supplier: TCI America D1957500ML
Specifications
| 1,3-Diisopropenylbenzene (stabilized with TBC) | |
| 500 mL | |
| C12H14 | |
| IBVPVTPPYGGAEL-UHFFFAOYSA-N | |
| 1,3-bis(prop-1-en-2-yl)benzene | |
| 77353 | |
| ≥97.0% (GC) | |
| 231°C |
| 3748-13-8 | |
| Yellow | |
| MFCD00008584 | |
| CC(=C)C1=CC(=CC=C1)C(=C)C | |
| 158.244 | |
| 158.24 | |
| -40°C | |
| Liquid |
Chemical Identifiers
| 3748-13-8 | |
| 158.244 | |
| IBVPVTPPYGGAEL-UHFFFAOYSA-N | |
| 1,3-bis(prop-1-en-2-yl)benzene |
| C12H14 | |
| MFCD00008584 | |
| 77353 | |
| CC(=C)C1=CC(=CC=C1)C(=C)C |
Safety and Handling
RTECSNumber : CY8535000
TSCA : Yes
Recommended Storage : Refrigerator