missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
1-(4-Chlorophenyl)-1-cyclopentanecarboxylic acid, 98%, Thermo Scientific™
$50.09 - $50.09
Chemical Identifiers
| CAS | 80789-69-1 |
|---|---|
| Molecular Formula | C12H13ClO2 |
| Molecular Weight (g/mol) | 224.69 |
| MDL Number | MFCD00001373 |
| InChI Key | QJNFJEMGWIQMJT-UHFFFAOYSA-N |
| Synonym | 1-4-chlorophenyl cyclopentanecarboxylic acid, 1-4-chlorophenyl-1-cyclopentanecarboxylic acid, 1-4-chlorophenyl cyclopentane-1-carboxylic acid, cyclopentanecarboxylic acid, 1-4-chlorophenyl, asischem d50961, timtec-bb sbb000649, acmc-209pk2, labotest-bb lt00453384, 1-4-chloro phenyl cyclopentanecarboxylic acid, 1-4-chloro-phenyl-cyclopentylcarboxylic acid |
| PubChem CID | 97447 |
| IUPAC Name | 1-(4-chlorophenyl)cyclopentane-1-carboxylic acid |
| SMILES | C1CCC(C1)(C2=CC=C(C=C2)Cl)C(=O)O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC161570050
|
Thermo Scientific Chemicals
161570050 |
5 g | Glass bottle |
Each for $50.09
|
|
||||
Chemical Identifiers
| 80789-69-1 | |
| 224.69 | |
| QJNFJEMGWIQMJT-UHFFFAOYSA-N | |
| 97447 | |
| C1CCC(C1)(C2=CC=C(C=C2)Cl)C(=O)O |
| C12H13ClO2 | |
| MFCD00001373 | |
| 1-4-chlorophenyl cyclopentanecarboxylic acid, 1-4-chlorophenyl-1-cyclopentanecarboxylic acid, 1-4-chlorophenyl cyclopentane-1-carboxylic acid, cyclopentanecarboxylic acid, 1-4-chlorophenyl, asischem d50961, timtec-bb sbb000649, acmc-209pk2, labotest-bb lt00453384, 1-4-chloro phenyl cyclopentanecarboxylic acid, 1-4-chloro-phenyl-cyclopentylcarboxylic acid | |
| 1-(4-chlorophenyl)cyclopentane-1-carboxylic acid |
Specifications
| 160.0°C to 164.0°C | |
| Cream to Gray | |
| 100.0 | |
| Authentic | |
| Crystalline Powder or Crystals | |
| C12H13ClO2 | |
| MFCD00001373 | |
| QJNFJEMGWIQMJT-UHFFFAOYSA-N | |
| 1-(4-chlorophenyl)cyclopentane-1-carboxylic acid | |
| 97447 | |
| 98% |
| 80789-69-1 | |
| 97.5 | |
| 5 g | |
| Glass bottle | |
| 98% | |
| ClC6H4C5H8CO2H | |
| 1-4-chlorophenyl cyclopentanecarboxylic acid, 1-4-chlorophenyl-1-cyclopentanecarboxylic acid, 1-4-chlorophenyl cyclopentane-1-carboxylic acid, cyclopentanecarboxylic acid, 1-4-chlorophenyl, asischem d50961, timtec-bb sbb000649, acmc-209pk2, labotest-bb lt00453384, 1-4-chloro phenyl cyclopentanecarboxylic acid, 1-4-chloro-phenyl-cyclopentylcarboxylic acid | |
| C1CCC(C1)(C2=CC=C(C=C2)Cl)C(=O)O | |
| 224.69 | |
| 224.69 | |
| 1-(4-Chlorophenyl)-1-cyclopentanecarboxylic acid |
Safety and Handling
EINECSNumber : 279-552-1
RUO – Research Use Only