missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
1,4-Naphthalenedicarboxylic Acid 95.0+%, TCI America™
$68.73 - $178.70
Chemical Identifiers
| CAS | 605-70-9 |
|---|---|
| Molecular Formula | C12H8O4 |
| Molecular Weight (g/mol) | 216.19 |
| MDL Number | MFCD00014312 |
| InChI Key | ABMFBCRYHDZLRD-UHFFFAOYSA-N |
| Synonym | 1,4-naphthalenedicarboxylic acid, 1,4-naphthalenedicarboxylicacid, 1,4-naphthalicacid, 1,4-naphthalic acid, pubchem21317, acmc-1b0c7, ksc357a6b, naphthalene-1,4-dicarboxylicacid, naphthalene-1,4-dicarboxlic acid, naphthaline-1,4-dicarboxylic acid |
| PubChem CID | 69065 |
| IUPAC Name | naphthalene-1,4-dicarboxylic acid |
| SMILES | OC(=O)C1=C2C=CC=CC2=C(C=C1)C(O)=O |
Chemical Identifiers
| 605-70-9 | |
| 216.19 | |
| ABMFBCRYHDZLRD-UHFFFAOYSA-N | |
| 69065 | |
| OC(=O)C1=C2C=CC=CC2=C(C=C1)C(O)=O |
| C12H8O4 | |
| MFCD00014312 | |
| 1,4-naphthalenedicarboxylic acid, 1,4-naphthalenedicarboxylicacid, 1,4-naphthalicacid, 1,4-naphthalic acid, pubchem21317, acmc-1b0c7, ksc357a6b, naphthalene-1,4-dicarboxylicacid, naphthalene-1,4-dicarboxlic acid, naphthaline-1,4-dicarboxylic acid | |
| naphthalene-1,4-dicarboxylic acid |
Specifications
| 605-70-9 | |
| C12H8O4 | |
| 25 g | |
| ABMFBCRYHDZLRD-UHFFFAOYSA-N | |
| naphthalene-1,4-dicarboxylic acid | |
| 69065 | |
| ≥95.0% (T) | |
| 1,4-Naphthalenedicarboxylic Acid |
| 320°C | |
| MFCD00014312 | |
| 1,4-naphthalenedicarboxylic acid, 1,4-naphthalenedicarboxylicacid, 1,4-naphthalicacid, 1,4-naphthalic acid, pubchem21317, acmc-1b0c7, ksc357a6b, naphthalene-1,4-dicarboxylicacid, naphthalene-1,4-dicarboxlic acid, naphthaline-1,4-dicarboxylic acid | |
| OC(=O)C1=C2C=CC=CC2=C(C=C1)C(O)=O | |
| 216.19 | |
| 216.19 | |
| Crystalline Powder |
Safety and Handling
EINECSNumber : (4)-1765
TSCA : Yes