missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
1-Benzothiophene-7-carboxylic acid, 97%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals CC29401DA
Specifications
| 1-Benzothiophene-7-carboxylic acid | |
| 97% | |
| C9H6O2S | |
| benzo b thiophene-7-carboxylic acid, benzo b thiophene-7-carboxylicacid, 7-carboxybenzo b thiophene, 1-benzo b thiophene-7-carboxylic acid | |
| C1=CC2=C(C(=C1)C(=O)O)SC=C2 | |
| 178.205 | |
| 178.21 |
| 10134-98-2 | |
| Amber Glass Bottle | |
| 1 g | |
| LJPSRTWIAXVPIS-UHFFFAOYSA-N | |
| 1-benzothiophene-7-carboxylic acid | |
| 14235073 | |
| 97% |
Chemical Identifiers
| 10134-98-2 | |
| 178.205 | |
| benzo b thiophene-7-carboxylic acid, benzo b thiophene-7-carboxylicacid, 7-carboxybenzo b thiophene, 1-benzo b thiophene-7-carboxylic acid | |
| 1-benzothiophene-7-carboxylic acid |
| C9H6O2S | |
| LJPSRTWIAXVPIS-UHFFFAOYSA-N | |
| 14235073 | |
| C1=CC2=C(C(=C1)C(=O)O)SC=C2 |