missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
1-(Carbamoylmethyl)cyclohexaneacetic Acid 98.0+%, TCI America™
Supplier: TCI America C209625G
Specifications
| 1-(Carbamoylmethyl)cyclohexaneacetic Acid | |
| 147°C | |
| C10H17NO3 | |
| 25 g | |
| QJGSJXLCJRXTRY-UHFFFAOYSA-N | |
| 2-[1-(2-amino-2-oxoethyl)cyclohexyl]acetic acid | |
| 665664 | |
| ≥98.0% (T) |
| 99189-60-3 | |
| White | |
| MFCD02181086 | |
| 1,1-cyclohexanediacetic acid monoamide, 1,1-cyclohexanediacetic acid mono amide, 2-1-2-amino-2-oxoethyl cyclohexyl acetic acid, 1-carbamoylmethyl cyclohexaneacetic acid, 3,3-pentamethyleneglutaramic acid, 1-2-amino-2-oxoethyl cyclohexyl acetic acid, 1-2-amino-2-oxoethyl cyclohexaneacetic acid, cyclohexaneacetic acid, 1-2-amino-2-oxoethyl, 1-carbamoylmethyl-cyclohexyl-acetic acid | |
| C1CCC(CC1)(CC(=O)N)CC(=O)O | |
| 199.25 | |
| 199.25 | |
| Crystalline Powder |
Chemical Identifiers
| 99189-60-3 | |
| 199.25 | |
| QJGSJXLCJRXTRY-UHFFFAOYSA-N | |
| 665664 | |
| C1CCC(CC1)(CC(=O)N)CC(=O)O |
| C10H17NO3 | |
| MFCD02181086 | |
| 1,1-cyclohexanediacetic acid monoamide, 1,1-cyclohexanediacetic acid mono amide, 2-1-2-amino-2-oxoethyl cyclohexyl acetic acid, 1-carbamoylmethyl cyclohexaneacetic acid, 3,3-pentamethyleneglutaramic acid, 1-2-amino-2-oxoethyl cyclohexyl acetic acid, 1-2-amino-2-oxoethyl cyclohexaneacetic acid, cyclohexaneacetic acid, 1-2-amino-2-oxoethyl, 1-carbamoylmethyl-cyclohexyl-acetic acid | |
| 2-[1-(2-amino-2-oxoethyl)cyclohexyl]acetic acid |
Safety and Handling
TSCA : No