missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
1-Hydroxyethane-1,1-diphosphonic Acid (ca. 60% in Water, ca. 4.2mol/L), TCI America™
$48.11 - $187.29
Chemical Identifiers
| CAS | 2809-21-4 |
|---|---|
| Molecular Formula | C2H8O7P2 |
| Molecular Weight (g/mol) | 206.027 |
| MDL Number | MFCD00070585 |
| InChI Key | DBVJJBKOTRCVKF-UHFFFAOYSA-N |
| Synonym | etidronic acid, etidronate, hedp, 1-hydroxyethylidene-1,1-diphosphonic acid, ehdp, etidronsaeure, acetodiphosphonic acid, hydroxyethanediphosphonic acid, oxyethylidenediphosphonic acid, turpinal sl |
| PubChem CID | 3305 |
| ChEBI | CHEBI:4907 |
| IUPAC Name | (1-hydroxy-1-phosphonoethyl)phosphonic acid |
| SMILES | CC(O)(P(=O)(O)O)P(=O)(O)O |
Chemical Identifiers
| 2809-21-4 | |
| 206.027 | |
| DBVJJBKOTRCVKF-UHFFFAOYSA-N | |
| 3305 | |
| (1-hydroxy-1-phosphonoethyl)phosphonic acid |
| C2H8O7P2 | |
| MFCD00070585 | |
| etidronic acid, etidronate, hedp, 1-hydroxyethylidene-1,1-diphosphonic acid, ehdp, etidronsaeure, acetodiphosphonic acid, hydroxyethanediphosphonic acid, oxyethylidenediphosphonic acid, turpinal sl | |
| CHEBI:4907 | |
| CC(O)(P(=O)(O)O)P(=O)(O)O |
Specifications
| 2809-21-4 | |
| Yellow | |
| C2H8O7P2 | |
| 25 g | |
| etidronic acid, etidronate, hedp, 1-hydroxyethylidene-1,1-diphosphonic acid, ehdp, etidronsaeure, acetodiphosphonic acid, hydroxyethanediphosphonic acid, oxyethylidenediphosphonic acid, turpinal sl | |
| CC(O)(P(=O)(O)O)P(=O)(O)O | |
| 206.027 | |
| CHEBI:4907 | |
| Liquid |
| -40°C | |
| 105°C | |
| MFCD00070585 | |
| 3265 | |
| DBVJJBKOTRCVKF-UHFFFAOYSA-N | |
| (1-hydroxy-1-phosphonoethyl)phosphonic acid | |
| 3305 | |
| 206.03 | |
| 1-Hydroxyethane-1,1-diphosphonic Acid (ca. 60% in Water, ca. 4.2mol/L) |
Safety and Handling
EINECSNumber : (2)-2936
RTECSNumber : SZ8562100
TSCA : Yes