missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
2,2,4-Trimethyl-1,3-pentanediol Diisobutyrate 98.5+%, TCI America™
Supplier: TCI America T099725ML
Specifications
| 2,2,4-Trimethyl-1,3-pentanediol Diisobutyrate | |
| -70°C | |
| 280°C | |
| MFCD00059267 | |
| 2,2,4-trimethyl-1,3-pentanediol diisobutyrate, kodaflex txib, 2,2,4-trimethylpentane-1,3-diyl bis 2-methylpropanoate, txib, propanoic acid, 2-methyl-, 2,2-dimethyl-1-1-methylethyl-1,3-propanediyl ester, 2,2,4-trimethylpentanediol-1,3-diisobutyrate, isobutyric acid, 1-isopropyl-2,2-dimethyltrimethylene ester, 1-isopropyl-2,2-dimethyltrimethylene diisobutyrate, 2,2,4-trimethyl-1,3-pentanediol ester, dsstox_cid_7635 | |
| CC(C)C(C(C)(C)COC(=O)C(C)C)OC(=O)C(C)C | |
| 286.412 | |
| 286.41 | |
| Liquid |
| 6846-50-0 | |
| Colorless | |
| C16H30O4 | |
| 25 mL | |
| OMVSWZDEEGIJJI-UHFFFAOYSA-N | |
| [2,2,4-trimethyl-3-(2-methylpropanoyloxy)pentyl] 2-methylpropanoate | |
| 23284 | |
| ≥98.5% (GC) |
Chemical Identifiers
| 6846-50-0 | |
| 286.412 | |
| OMVSWZDEEGIJJI-UHFFFAOYSA-N | |
| 23284 | |
| CC(C)C(C(C)(C)COC(=O)C(C)C)OC(=O)C(C)C |
| C16H30O4 | |
| MFCD00059267 | |
| 2,2,4-trimethyl-1,3-pentanediol diisobutyrate, kodaflex txib, 2,2,4-trimethylpentane-1,3-diyl bis 2-methylpropanoate, txib, propanoic acid, 2-methyl-, 2,2-dimethyl-1-1-methylethyl-1,3-propanediyl ester, 2,2,4-trimethylpentanediol-1,3-diisobutyrate, isobutyric acid, 1-isopropyl-2,2-dimethyltrimethylene ester, 1-isopropyl-2,2-dimethyltrimethylene diisobutyrate, 2,2,4-trimethyl-1,3-pentanediol ester, dsstox_cid_7635 | |
| [2,2,4-trimethyl-3-(2-methylpropanoyloxy)pentyl] 2-methylpropanoate |
Safety and Handling
EINECSNumber : (2)-2498
RTECSNumber : SA1420000
TSCA : Yes