missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
2,2-Bithiophene-5-carboxylic acid, 97%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals CC14601DA
Specifications
| 2, 2'-Bithiophene-5-carboxylic acid | |
| 97% | |
| C9H6O2S2 | |
| 2,2'-bithiophene-5-carboxylic acid, 5-thiophen-2-yl thiophene-2-carboxylic acid, 2,2-bithiophene-5-carboxylic acid, 2,2'-bithiophene-5-carboxylicacid, 2,2' bithiophenyl-5-carboxylic acid, 2,2'-bithiophene-5-ca, 5-carboxy-2,2'-bithiophene, 2,2'-bithienyl-5'-carboxylic, 5-2-thienyl-2-thiophenecarboxylic acid | |
| C1=CSC(=C1)C2=CC=C(S2)C(=O)O | |
| 210.265 | |
| 210.28 |
| 2060-55-1 | |
| Amber Glass Bottle | |
| 1 g | |
| PTNWHEHDBNNKEO-UHFFFAOYSA-N | |
| 5-thiophen-2-ylthiophene-2-carboxylic acid | |
| 150965 | |
| 97% |
Chemical Identifiers
| 2060-55-1 | |
| 210.265 | |
| 2,2'-bithiophene-5-carboxylic acid, 5-thiophen-2-yl thiophene-2-carboxylic acid, 2,2-bithiophene-5-carboxylic acid, 2,2'-bithiophene-5-carboxylicacid, 2,2' bithiophenyl-5-carboxylic acid, 2,2'-bithiophene-5-ca, 5-carboxy-2,2'-bithiophene, 2,2'-bithienyl-5'-carboxylic, 5-2-thienyl-2-thiophenecarboxylic acid | |
| 5-thiophen-2-ylthiophene-2-carboxylic acid |
| C9H6O2S2 | |
| PTNWHEHDBNNKEO-UHFFFAOYSA-N | |
| 150965 | |
| C1=CSC(=C1)C2=CC=C(S2)C(=O)O |
Safety and Handling
GHS Signal Word: Warning