missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
2,4,6-Trivinylboroxin - Pyridine Complex 98.0+%, TCI America™
$158.17 - $546.87
Chemical Identifiers
| CAS | 95010-17-6 |
|---|---|
| Molecular Formula | C11H14B3NO3 |
| Molecular Weight (g/mol) | 240.667 |
| MDL Number | MFCD03839440 |
| InChI Key | YLHJACXHRQQNQR-UHFFFAOYSA-N |
| Synonym | 2,4,6-trivinyl-1,3,5,2,4,6-trioxatriborinane compound with pyridine 1:1, trivinylboroxin pyridine complex, vinylboronic anhydride pyridine complex, 2,4,6-trivinylcyclotriboroxane-pyridine, 2,4,6-trivinylcyclotriboroxane pyridine, vinylboronic anhydride pyridine, 2,4,6-trivinylcyclotriboroxane pyridine complex, 2,4,6-trivinylcyclotriboroxane-pyridine complex, boroxin, triethenyl-, compd. with pyridine 1:1, pyridine; triethenyl-1,3,5,2,4,6-trioxatriborinane |
| PubChem CID | 2734806 |
| IUPAC Name | pyridine;2,4,6-tris(ethenyl)-1,3,5,2,4,6-trioxatriborinane |
| SMILES | B1(OB(OB(O1)C=C)C=C)C=C.C1=CC=NC=C1 |
Chemical Identifiers
| 95010-17-6 | |
| 240.667 | |
| YLHJACXHRQQNQR-UHFFFAOYSA-N | |
| 2734806 | |
| B1(OB(OB(O1)C=C)C=C)C=C.C1=CC=NC=C1 |
| C11H14B3NO3 | |
| MFCD03839440 | |
| 2,4,6-trivinyl-1,3,5,2,4,6-trioxatriborinane compound with pyridine 1:1, trivinylboroxin pyridine complex, vinylboronic anhydride pyridine complex, 2,4,6-trivinylcyclotriboroxane-pyridine, 2,4,6-trivinylcyclotriboroxane pyridine, vinylboronic anhydride pyridine, 2,4,6-trivinylcyclotriboroxane pyridine complex, 2,4,6-trivinylcyclotriboroxane-pyridine complex, boroxin, triethenyl-, compd. with pyridine 1:1, pyridine; triethenyl-1,3,5,2,4,6-trioxatriborinane | |
| pyridine;2,4,6-tris(ethenyl)-1,3,5,2,4,6-trioxatriborinane |
Specifications
| 95010-17-6 | |
| White-Yellow | |
| MFCD03839440 | |
| 2,4,6-trivinyl-1,3,5,2,4,6-trioxatriborinane compound with pyridine 1:1, trivinylboroxin pyridine complex, vinylboronic anhydride pyridine complex, 2,4,6-trivinylcyclotriboroxane-pyridine, 2,4,6-trivinylcyclotriboroxane pyridine, vinylboronic anhydride pyridine, 2,4,6-trivinylcyclotriboroxane pyridine complex, 2,4,6-trivinylcyclotriboroxane-pyridine complex, boroxin, triethenyl-, compd. with pyridine 1:1, pyridine; triethenyl-1,3,5,2,4,6-trioxatriborinane | |
| B1(OB(OB(O1)C=C)C=C)C=C.C1=CC=NC=C1 | |
| 240.667 | |
| 240.67 | |
| Crystalline Powder |
| 51°C | |
| C11H14B3NO3 | |
| 1 g | |
| YLHJACXHRQQNQR-UHFFFAOYSA-N | |
| pyridine;2,4,6-tris(ethenyl)-1,3,5,2,4,6-trioxatriborinane | |
| 2734806 | |
| ≥98.0% (T) | |
| 2,4,6-Trivinylboroxin - Pyridine Complex |
Safety and Handling
TSCA : No