missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic Acid 98.0+%, TCI America™
$43.44 - $112.57
Chemical Identifiers
| CAS | 269409-73-6 |
|---|---|
| Molecular Formula | C13H17BO4 |
| Molecular Weight (g/mol) | 248.09 |
| MDL Number | MFCD03411930 |
| InChI Key | OPWAPCOSDAFWFB-UHFFFAOYSA-N |
| Synonym | 3-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl benzoic acid, 3-carboxyphenylboronic acid pinacol ester, 3-carboxyphenylboronic acid, pinacol ester, 3-carboxyphenyl boronic acid, pinacol ester, benzoic acid, 3-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl, 3-tetramethyl-1,3,2-dioxaborolan-2-yl benzoic acid, 3-carboxyphenylboronicacidpinacolester, pubchem17048, 3-cpbe, amtb044 |
| PubChem CID | 2734653 |
| IUPAC Name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| SMILES | CC1(C)OB(OC1(C)C)C1=CC=CC(=C1)C(O)=O |
Chemical Identifiers
| 269409-73-6 | |
| 248.09 | |
| OPWAPCOSDAFWFB-UHFFFAOYSA-N | |
| 2734653 | |
| CC1(C)OB(OC1(C)C)C1=CC=CC(=C1)C(O)=O |
| C13H17BO4 | |
| MFCD03411930 | |
| 3-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl benzoic acid, 3-carboxyphenylboronic acid pinacol ester, 3-carboxyphenylboronic acid, pinacol ester, 3-carboxyphenyl boronic acid, pinacol ester, benzoic acid, 3-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl, 3-tetramethyl-1,3,2-dioxaborolan-2-yl benzoic acid, 3-carboxyphenylboronicacidpinacolester, pubchem17048, 3-cpbe, amtb044 | |
| 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
Specifications
| 269409-73-6 | |
| White | |
| MFCD03411930 | |
| 3-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl benzoic acid, 3-carboxyphenylboronic acid pinacol ester, 3-carboxyphenylboronic acid, pinacol ester, 3-carboxyphenyl boronic acid, pinacol ester, benzoic acid, 3-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl, 3-tetramethyl-1,3,2-dioxaborolan-2-yl benzoic acid, 3-carboxyphenylboronicacidpinacolester, pubchem17048, 3-cpbe, amtb044 | |
| CC1(C)OB(OC1(C)C)C1=CC=CC(=C1)C(O)=O | |
| 248.09 | |
| 248.09 | |
| Crystalline Powder |
| 210°C | |
| C13H17BO4 | |
| 1 g | |
| OPWAPCOSDAFWFB-UHFFFAOYSA-N | |
| 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid | |
| 2734653 | |
| ≥98.0% (GC,T) | |
| 3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic Acid |
Safety and Handling
TSCA : No