missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
3-Nitrocinnamic Acid 98.0+%, TCI America™
Supplier: TCI America N03545G
Specifications
| 3-Nitrocinnamic Acid | |
| 205°C | |
| C9H7NO4 | |
| 5 g | |
| WWXMVRYHLZMQIG-SNAWJCMRSA-N | |
| 193.158 | |
| CHEBI:60706 | |
| ≥98.0% (T) |
| 555-68-0 | |
| White-Yellow | |
| MFCD00007277 | |
| 3-nitrocinnamic acid, m-nitrocinnamic acid, 3-nitro-cinnamic acid, cinnamic acid, m-nitro, trans-3-nitrocinnamic acid, 3-nitrobenzenepropenoic acid, e-3-3-nitrophenyl-2-propenoic acid, 2e-3-3-nitrophenyl prop-2-enoic acid, 2e-3-3-nitrophenyl acrylic acid, unii-z5wu65j930 | |
| C1=CC(=CC(=C1)[N+](=O)[O-])C=CC(=O)O | |
| 687126 | |
| 193.16 | |
| Crystalline Powder |
Chemical Identifiers
| 555-68-0 | |
| 193.158 | |
| WWXMVRYHLZMQIG-SNAWJCMRSA-N | |
| 687126 | |
| C1=CC(=CC(=C1)[N+](=O)[O-])C=CC(=O)O |
| C9H7NO4 | |
| MFCD00007277 | |
| 3-nitrocinnamic acid, m-nitrocinnamic acid, 3-nitro-cinnamic acid, cinnamic acid, m-nitro, trans-3-nitrocinnamic acid, 3-nitrobenzenepropenoic acid, e-3-3-nitrophenyl-2-propenoic acid, 2e-3-3-nitrophenyl prop-2-enoic acid, 2e-3-3-nitrophenyl acrylic acid, unii-z5wu65j930 | |
| CHEBI:60706 |
Safety and Handling
RTECSNumber : GE0352000
TSCA : Yes