missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
4-(1-Pyrrolidinyl)benzoic acid, Thermo Scientific™
Supplier: Thermo Scientific Chemicals CC30101DA
Specifications
| 4-(1-Pyrrolidinyl)benzoic acid | |
| 97% | |
| C11H13NO2 | |
| 1 g | |
| KPCBFFYRSJPCJH-UHFFFAOYSA-N | |
| 4-pyrrolidin-1-ylbenzoic acid | |
| 2795515 | |
| 97% |
| 22090-27-3 | |
| Amber Glass Bottle | |
| MFCD01631241 | |
| 4-pyrrolidin-1-yl benzoic acid, 4-1-pyrrolidinyl benzoic acid, 4-pyrrolidin-1-yl-benzoic acid, 4-1-pyrrolidinyl benzenecarboxylic acid, benzoic acid,4-1-pyrrolidinyl, benzoic acid, 4-1-pyrrolidinyl, 4-pyrrolidinylbenzoic acid, pubchem19562, 1-4-carboxyphenyl pyrrolidine | |
| OC(=O)C1=CC=C(C=C1)N1CCCC1 | |
| 191.23 | |
| 191.23 |
Chemical Identifiers
| 22090-27-3 | |
| 191.23 | |
| KPCBFFYRSJPCJH-UHFFFAOYSA-N | |
| OC(=O)C1=CC=C(C=C1)N1CCCC1 |
| C11H13NO2 | |
| MFCD01631241 | |
| 2795515 |
Safety and Handling
Warning