missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
4,4'-Azo-bis(4-cyanovaleric acid), ∽98%, MP Biomedicals™
$331.45 - $331.45
Chemical Identifiers
| CAS | 2638-94-0 |
|---|---|
| Molecular Formula | C12H16N4O4 |
| Molecular Weight (g/mol) | 280.284 |
| MDL Number | MFCD00002799 |
| InChI Key | VFXXTYGQYWRHJP-UHFFFAOYSA-N |
| Synonym | 4,4'-azobis 4-cyanovaleric acid, azobis cyanovaleric acid, 4,4'-diazene-1,2-diyl bis 4-cyanopentanoic acid, 4,4'-azobis 4-cyanopentanoic acid, acva, 4,4-azobis 4-cyanovaleric acid, valeric acid, 4,4'-azobis 4-cyano, pentanoic acid, 4,4'-azobis 4-cyano, 4,4'-azobis 4-cyano valeric acid acva |
| PubChem CID | 92938 |
| IUPAC Name | 4-[(4-carboxy-2-cyanobutan-2-yl)diazenyl]-4-cyanopentanoic acid |
| SMILES | CC(CCC(=O)O)(C#N)N=NC(C)(CCC(=O)O)C#N |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
ICN15041225
|
MP Biomedicals Inc
0215041225 |
25 g |
Each for $331.45
|
|
|||||
Chemical Identifiers
| 2638-94-0 | |
| 280.284 | |
| VFXXTYGQYWRHJP-UHFFFAOYSA-N | |
| 92938 | |
| CC(CCC(=O)O)(C#N)N=NC(C)(CCC(=O)O)C#N |
| C12H16N4O4 | |
| MFCD00002799 | |
| 4,4'-azobis 4-cyanovaleric acid, azobis cyanovaleric acid, 4,4'-diazene-1,2-diyl bis 4-cyanopentanoic acid, 4,4'-azobis 4-cyanopentanoic acid, acva, 4,4-azobis 4-cyanovaleric acid, valeric acid, 4,4'-azobis 4-cyano, pentanoic acid, 4,4'-azobis 4-cyano, 4,4'-azobis 4-cyano valeric acid acva | |
| 4-[(4-carboxy-2-cyanobutan-2-yl)diazenyl]-4-cyanopentanoic acid |
Specifications
| 2638-94-0 | |
| ∽ 98% | |
| MFCD00002799 | |
| VFXXTYGQYWRHJP-UHFFFAOYSA-N | |
| 4-[(4-carboxy-2-cyanobutan-2-yl)diazenyl]-4-cyanopentanoic acid | |
| 280.284 | |
| 280.28 | |
| 4, 4'-Azo-bis(4-cyanovaleric acid), Polymer synthesis |
| White | |
| C12H16N4O4 | |
| 4,4'-azobis 4-cyanovaleric acid, azobis cyanovaleric acid, 4,4'-diazene-1,2-diyl bis 4-cyanopentanoic acid, 4,4'-azobis 4-cyanopentanoic acid, acva, 4,4-azobis 4-cyanovaleric acid, valeric acid, 4,4'-azobis 4-cyano, pentanoic acid, 4,4'-azobis 4-cyano, 4,4'-azobis 4-cyano valeric acid acva | |
| CC(CCC(=O)O)(C#N)N=NC(C)(CCC(=O)O)C#N | |
| 25 g | |
| 92938 | |
| Powder |
Safety and Handling
storageNote1 : Protect from light.
Recommended Storage : Store at 4°C.