missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
4,4'-Biphenyldisulfonyl Chloride 97.0+%, TCI America™
Supplier: TCI America B116525G
Specifications
| 4,4′-Biphenyldisulfonyl Chloride | |
| 207°C | |
| C12H8Cl2O4S2 | |
| 25 g | |
| 4,4′C-Biphenyldisulfonyl Dichloride, 4,4′C-Diphenyldisulfonyl Chloride | |
| ClS(=O)(=O)C1=CC=C(C=C1)C1=CC=C(C=C1)S(Cl)(=O)=O | |
| 351.21 | |
| 351.21 | |
| Crystalline Powder |
| 3406-84-6 | |
| White-Yellow | |
| MFCD00007447 | |
| 3261 | |
| OTFAWEIFBPUXOH-UHFFFAOYSA-N | |
| [1,1'-biphenyl]-4,4'-disulfonyl dichloride | |
| 76950 | |
| ≥97.0% (T) |
Chemical Identifiers
| 3406-84-6 | |
| 351.21 | |
| OTFAWEIFBPUXOH-UHFFFAOYSA-N | |
| 76950 | |
| ClS(=O)(=O)C1=CC=C(C=C1)C1=CC=C(C=C1)S(Cl)(=O)=O |
| C12H8Cl2O4S2 | |
| MFCD00007447 | |
| 4,4′C-Biphenyldisulfonyl Dichloride, 4,4′C-Diphenyldisulfonyl Chloride | |
| [1,1'-biphenyl]-4,4'-disulfonyl dichloride |
Safety and Handling
TSCA : Yes