missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
4,4'-Diaminodiphenylmethane 98.0+%, TCI America™
Supplier: TCI America M0220500G
Specifications
| 4,4′-Diaminodiphenylmethane | |
| 91°C | |
| 257°C | |
| MFCD00007914 | |
| 2651 | |
| YBRVSVVVWCFQMG-UHFFFAOYSA-N | |
| 4-[(4-aminophenyl)methyl]aniline | |
| 7577 | |
| 198.27 | |
| Pellets |
| 101-77-9 | |
| White-Yellow | |
| C13H14N2 | |
| 500 g | |
| 4,4'-methylenedianiline, 4,4'-diaminodiphenylmethane, dadpm, methylenedianiline, dianilinomethane, tonox, p,p'-methylenedianiline, dianilinemethane, bis 4-aminophenyl methane, 4-4-aminobenzyl aniline | |
| NC1=CC=C(CC2=CC=C(N)C=C2)C=C1 | |
| 198.27 | |
| CHEBI:32506 | |
| ≥98.0% (T) |
Chemical Identifiers
| 101-77-9 | |
| 198.27 | |
| YBRVSVVVWCFQMG-UHFFFAOYSA-N | |
| 7577 | |
| 4-[(4-aminophenyl)methyl]aniline |
| C13H14N2 | |
| MFCD00007914 | |
| 4,4'-methylenedianiline, 4,4'-diaminodiphenylmethane, dadpm, methylenedianiline, dianilinomethane, tonox, p,p'-methylenedianiline, dianilinemethane, bis 4-aminophenyl methane, 4-4-aminobenzyl aniline | |
| CHEBI:32506 | |
| NC1=CC=C(CC2=CC=C(N)C=C2)C=C1 |
Safety and Handling
EINECSNumber : (4)-0040
RTECSNumber : BY5425000
TSCA : Yes