missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
4,4'-Diaminodiphenylmethane 98.0+%, TCI America™
$32.87 - $76.13
Chemical Identifiers
| CAS | 101-77-9 |
|---|---|
| Molecular Formula | C13H14N2 |
| Molecular Weight (g/mol) | 198.27 |
| MDL Number | MFCD00007914 |
| InChI Key | YBRVSVVVWCFQMG-UHFFFAOYSA-N |
| Synonym | 4,4'-methylenedianiline, 4,4'-diaminodiphenylmethane, dadpm, methylenedianiline, dianilinomethane, tonox, p,p'-methylenedianiline, dianilinemethane, bis 4-aminophenyl methane, 4-4-aminobenzyl aniline |
| PubChem CID | 7577 |
| ChEBI | CHEBI:32506 |
| IUPAC Name | 4-[(4-aminophenyl)methyl]aniline |
| SMILES | NC1=CC=C(CC2=CC=C(N)C=C2)C=C1 |
Chemical Identifiers
| 101-77-9 | |
| 198.27 | |
| YBRVSVVVWCFQMG-UHFFFAOYSA-N | |
| 7577 | |
| 4-[(4-aminophenyl)methyl]aniline |
| C13H14N2 | |
| MFCD00007914 | |
| 4,4'-methylenedianiline, 4,4'-diaminodiphenylmethane, dadpm, methylenedianiline, dianilinomethane, tonox, p,p'-methylenedianiline, dianilinemethane, bis 4-aminophenyl methane, 4-4-aminobenzyl aniline | |
| CHEBI:32506 | |
| NC1=CC=C(CC2=CC=C(N)C=C2)C=C1 |
Specifications
| 101-77-9 | |
| White-Yellow | |
| C13H14N2 | |
| 25 g | |
| 4,4'-methylenedianiline, 4,4'-diaminodiphenylmethane, dadpm, methylenedianiline, dianilinomethane, tonox, p,p'-methylenedianiline, dianilinemethane, bis 4-aminophenyl methane, 4-4-aminobenzyl aniline | |
| NC1=CC=C(CC2=CC=C(N)C=C2)C=C1 | |
| 198.27 | |
| CHEBI:32506 | |
| ≥98.0% (T) | |
| 4,4′-Diaminodiphenylmethane |
| 91°C | |
| 257°C | |
| MFCD00007914 | |
| 2651 | |
| YBRVSVVVWCFQMG-UHFFFAOYSA-N | |
| 4-[(4-aminophenyl)methyl]aniline | |
| 7577 | |
| 198.27 | |
| Pellets |
Safety and Handling
EINECSNumber : (4)-0040
RTECSNumber : BY5425000
TSCA : Yes