missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
5-Methyl-2-phenyl-1,3-oxazole-4-carboxylic acid, 97%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals CC26701CB
Specifications
| 5-Methyl-2-phenyl-1, 3-oxazole-4-carboxylic acid | |
| 97% | |
| C11H8NO3 | |
| 250mg | |
| YABCPNYCFFUVNM-UHFFFAOYSA-M | |
| 5-methyl-2-phenyl-1,3-oxazole-4-carboxylic acid | |
| 318533 | |
| 97% |
| 18735-74-5 | |
| Amber Glass Bottle | |
| MFCD00275475 | |
| 5-methyl-2-phenyloxazole-4-carboxylic acid, 2-phenyl-5-methyloxazole-4-carboxylic acid, 5-methyl-2-phenyl-oxazole-4-carboxylic acid, 4-oxazolecarboxylic acid, 5-methyl-2-phenyl, 5-methyl-2-phenyloxazole-4-carboxylicacid, 4-carboxy-5-methyl-2-phenyl-1,3-oxazole, 4-oxazolecarboxylicacid,5-methyl-2-phenyl, 2-phenyl-5-methyl-oxazole-4-carboxylic acid, 4-oxazolecarboxylicacid, 5-methyl-2-phenyl, 5-methyl-2-phenyloxazol-4-ylcarboxylic acid | |
| CC1=C(N=C(O1)C1=CC=CC=C1)C([O-])=O | |
| 202.19 | |
| 203.2 |
Chemical Identifiers
| 18735-74-5 | |
| 202.19 | |
| YABCPNYCFFUVNM-UHFFFAOYSA-M | |
| 318533 | |
| CC1=C(N=C(O1)C1=CC=CC=C1)C([O-])=O |
| C11H8NO3 | |
| MFCD00275475 | |
| 5-methyl-2-phenyloxazole-4-carboxylic acid, 2-phenyl-5-methyloxazole-4-carboxylic acid, 5-methyl-2-phenyl-oxazole-4-carboxylic acid, 4-oxazolecarboxylic acid, 5-methyl-2-phenyl, 5-methyl-2-phenyloxazole-4-carboxylicacid, 4-carboxy-5-methyl-2-phenyl-1,3-oxazole, 4-oxazolecarboxylicacid,5-methyl-2-phenyl, 2-phenyl-5-methyl-oxazole-4-carboxylic acid, 4-oxazolecarboxylicacid, 5-methyl-2-phenyl, 5-methyl-2-phenyloxazol-4-ylcarboxylic acid | |
| 5-methyl-2-phenyl-1,3-oxazole-4-carboxylic acid |