missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Specifications
| Acid Black 1 | |
| C22H14N6Na2O9S2 | |
| 25 g | |
| HKBVRFLHNUEVRO-UHFFFAOYSA-L | |
| disodium;4-amino-3-[(4-nitrophenyl)diazenyl]-5-oxo-6-(phenylhydrazinylidene)naphthalene-2,7-disulfonate | |
| 44134531 | |
| ≥97.0% (HPLC) |
| 1064-48-8 | |
| MFCD00004017 | |
| amido black 10b, acid black 1, buffalo black nbr, naphthol blue black, parent, aniline blue black, tech, nigrosine water soluble, 4-amino-5-hydroxy-3-4-nitrophenyl azo-6-phenylazo naphthalene-2,7-disulphonic acid, sodium salt, 2,7-naphthalenedisulfonic acid, 4-amino-5-hydroxy-3-4-nitrophenyl azo-6-phenylazo-, sodium salt, 3-4-nitrophenylazo-4-amino-5-oxo-6-2-phenylhydrazono-5,6-dihydro-2,7-naphthalenedisulfonic acid disodium salt | |
| C1=CC=C(C=C1)NN=C2C(=CC3=CC(=C(C(=C3C2=O)N)N=NC4=CC=C(C=C4)[N+](=O)[O-])S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+] | |
| 616.487 | |
| 616.49 | |
| Crystalline Powder |
Chemical Identifiers
| 1064-48-8 | |
| 616.487 | |
| HKBVRFLHNUEVRO-UHFFFAOYSA-L | |
| 44134531 | |
| C1=CC=C(C=C1)NN=C2C(=CC3=CC(=C(C(=C3C2=O)N)N=NC4=CC=C(C=C4)[N+](=O)[O-])S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+] |
| C22H14N6Na2O9S2 | |
| MFCD00004017 | |
| amido black 10b, acid black 1, buffalo black nbr, naphthol blue black, parent, aniline blue black, tech, nigrosine water soluble, 4-amino-5-hydroxy-3-4-nitrophenyl azo-6-phenylazo naphthalene-2,7-disulphonic acid, sodium salt, 2,7-naphthalenedisulfonic acid, 4-amino-5-hydroxy-3-4-nitrophenyl azo-6-phenylazo-, sodium salt, 3-4-nitrophenylazo-4-amino-5-oxo-6-2-phenylhydrazono-5,6-dihydro-2,7-naphthalenedisulfonic acid disodium salt | |
| disodium;4-amino-3-[(4-nitrophenyl)diazenyl]-5-oxo-6-(phenylhydrazinylidene)naphthalene-2,7-disulfonate |
Safety and Handling
EINECSNumber : (5)-1875&(5)-5232
RTECSNumber : QJ6196000
TSCA : Yes