missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
![Benzo[a]phenanthrene (purified by sublimation) 98.0+%, TCI America™](https://assets.fishersci.com/TFS-Assets/CCG/Chemical-Structures/chemical-structure-cas-218-01-9.jpg-650.jpg)
![Benzo[a]phenanthrene (purified by sublimation) 98.0+%, TCI America™](https://assets.fishersci.com/TFS-Assets/CCG/TCI-America/logos/Rings Blue.jpg-650.jpg)
Benzo[a]phenanthrene (purified by sublimation) 98.0+%, TCI America™
Supplier: TCI America C03391G
Specifications
| Benzo[a]phenanthrene (purified by sublimation) | |
| 255°C | |
| C18H12 | |
| 1 g | |
| benzo a phenanthrene, 1,2-benzophenanthrene, 1,2-benzphenanthrene, 1,2,5,6-dibenzonaphthalene, benz a phenanthrene, chrysen, rcra waste number u050, rcra waste no. u050 | |
| C1=CC=C2C(=C1)C=CC3=C2C=CC4=CC=CC=C43 | |
| 228.294 | |
| CHEBI:51687 | |
| ≥98.0% (GC) |
| 218-01-9 | |
| 448°C | |
| MFCD00003698 | |
| 3077 | |
| WDECIBYCCFPHNR-UHFFFAOYSA-N | |
| chrysene | |
| 9171 | |
| 228.29 | |
| Crystalline Powder |
Chemical Identifiers
| 218-01-9 | |
| 228.294 | |
| WDECIBYCCFPHNR-UHFFFAOYSA-N | |
| 9171 | |
| chrysene |
| C18H12 | |
| MFCD00003698 | |
| benzo a phenanthrene, 1,2-benzophenanthrene, 1,2-benzphenanthrene, 1,2,5,6-dibenzonaphthalene, benz a phenanthrene, chrysen, rcra waste number u050, rcra waste no. u050 | |
| CHEBI:51687 | |
| C1=CC=C2C(=C1)C=CC3=C2C=CC4=CC=CC=C43 |
Safety and Handling
RTECSNumber : GC0700000
TSCA : Yes