missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Calcium Phosphate, Monobasic, Monohydrate, Crystal, BAKER ANALYZED™ Reagent, J.T. Baker™
High quality chemicals for laboratory and specialized industrial use
Supplier: Avantor J.T.Baker 142601
Specifications
Calcium Phosphate | |
7758-23-8 | |
500 g | |
calcium biphosphate, monobasic calcium phosphate, calcium dihydrogen phosphate, acid calcium phosphate, primary calcium phosphate, monocalcium orthophosphate, c 38 phosphate, calcium diorthophosphate, monocalcium phosphate, monobasic, calcium dihydrogen orthophosphate | |
OP(=O)(O)[O-].OP(=O)(O)[O-].[Ca+2] | |
234.05 | |
CHEBI:35433 | |
BAKER ANALYZED™ Reagent | |
1L = 2.22kg |
Monobasic, Monohydrate | |
Crystals | |
CaH4O8P2 | |
YYRMJZQKEFZXMX-UHFFFAOYSA-L | |
calcium;dihydrogen phosphate | |
24454 | |
252.07 | |
Poly Bottle |
Chemical Identifiers
7758-23-8 | |
234.05 | |
calcium biphosphate, monobasic calcium phosphate, calcium dihydrogen phosphate, acid calcium phosphate, primary calcium phosphate, monocalcium orthophosphate, c 38 phosphate, calcium diorthophosphate, monocalcium phosphate, monobasic, calcium dihydrogen orthophosphate | |
CHEBI:35433 | |
OP(=O)(O)[O-].OP(=O)(O)[O-].[Ca+2] |
CaH4O8P2 | |
YYRMJZQKEFZXMX-UHFFFAOYSA-L | |
24454 | |
calcium;dihydrogen phosphate |