missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Carboxymethyl Cellulose Sodium Salt (n=approx. 500), TCI America™
Supplier: TCI America C004525G
Specifications
| Carboxymethyl Cellulose Sodium Salt (n=approx. 500) | |
| (C12 H14 O9 R6)n | |
| 25 g | |
| DPXJVFZANSGRMM-UHFFFAOYNA-N | |
| 2,3,4,5,6-pentahydroxyhexanal acetic acid sodium | |
| 23706213 |
| 9004-32-4 | |
| MFCD00081472 | |
| carboxymethylcellulose sodium usp, celluvisc tn, carmellose sodium jp17, sodium dextrose acetate, c.m.c. tn | |
| [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O | |
| 263.20 | |
| Crystalline Powder |
Chemical Identifiers
| 9004-32-4 | |
| 263.20 | |
| DPXJVFZANSGRMM-UHFFFAOYNA-N | |
| 23706213 | |
| [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O |
| (C12 H14 O9 R6)n | |
| MFCD00081472 | |
| carboxymethylcellulose sodium usp, celluvisc tn, carmellose sodium jp17, sodium dextrose acetate, c.m.c. tn | |
| 2,3,4,5,6-pentahydroxyhexanal acetic acid sodium |
Safety and Handling
EINECSNumber : (8)-0203
RTECSNumber : FJ5950000
TSCA : Yes